5-(2,4-dinitrophenyl)sulfanyl-3-(4-nitrophenyl)-1,2,4-oxadiazole structure
|
Common Name | 5-(2,4-dinitrophenyl)sulfanyl-3-(4-nitrophenyl)-1,2,4-oxadiazole | ||
|---|---|---|---|---|
| CAS Number | 89333-94-8 | Molecular Weight | 389.30000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H7N5O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(2,4-dinitrophenyl)sulfanyl-3-(4-nitrophenyl)-1,2,4-oxadiazole |
|---|
| Molecular Formula | C14H7N5O7S |
|---|---|
| Molecular Weight | 389.30000 |
| Exact Mass | 389.00700 |
| PSA | 201.68000 |
| LogP | 5.18200 |
| InChIKey | JHYXGKIVIMTVGH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(-c2noc(Sc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])n2)cc1 |
|
~64%
5-(2,4-dinitrop... CAS#:89333-94-8 |
| Literature: Paton, Michael R.; Hamilton, Douglas G. Tetrahedron Letters, 1983 , vol. 24, # 46 p. 5141 - 5142 |
|
~64%
5-(2,4-dinitrop... CAS#:89333-94-8 |
| Literature: Greig, Derek J.; Hamilton, Douglas G.; McPherson, Michael; Paton, R. Michael; Crosby, John Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1987 , p. 607 - 612 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |