[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]thiourea structure
|
Common Name | [5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]thiourea | ||
|---|---|---|---|---|
| CAS Number | 89335-08-0 | Molecular Weight | 266.34300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10N4OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]thiourea |
|---|
| Molecular Formula | C10H10N4OS2 |
|---|---|
| Molecular Weight | 266.34300 |
| Exact Mass | 266.03000 |
| PSA | 141.16000 |
| LogP | 2.01180 |
| InChIKey | AVLWMCPILDHUMG-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2nnc(NC(N)=S)s2)cc1 |
|
~%
[5-(4-methoxyph... CAS#:89335-08-0 |
| Literature: Naik; Meher; Nayak Journal of the Indian Chemical Society, 1983 , vol. 60, # 7 p. 674 - 678 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |