[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]thiourea structure
|
Common Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]thiourea | ||
|---|---|---|---|---|
| CAS Number | 89335-13-7 | Molecular Weight | 265.24900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7N5O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]thiourea |
|---|
| Molecular Formula | C9H7N5O3S |
|---|---|
| Molecular Weight | 265.24900 |
| Exact Mass | 265.02700 |
| PSA | 162.65000 |
| LogP | 1.96610 |
| InChIKey | VJDGWHWZBWYHIP-UHFFFAOYSA-N |
| SMILES | NC(=S)Nc1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
|
~%
[5-(4-nitrophen... CAS#:89335-13-7 |
| Literature: Khare, R. K.; Srivastava, M. K.; Singh, H. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1995 , vol. 34, # 9 p. 828 - 831 |
|
~%
[5-(4-nitrophen... CAS#:89335-13-7 |
| Literature: Naik; Meher; Nayak Journal of the Indian Chemical Society, 1983 , vol. 60, # 7 p. 674 - 678 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |