2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethanone
Modify Date: 2025-08-26 14:55:59
![2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethanone Structure](https://image.chemsrc.com/caspic/230/893407-15-3.png)
2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethanone structure
|
Common Name | 2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 893407-15-3 | Molecular Weight | 296.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11F3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H11F3OS |
|---|---|
| Molecular Weight | 296.30700 |
| Exact Mass | 296.04800 |
| PSA | 42.37000 |
| LogP | 4.82050 |
| InChIKey | RDBJQDMMWXAZRS-UHFFFAOYSA-N |
| SMILES | CSc1ccc(-c2ccc(C(=O)C(F)(F)F)cc2)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:893407-18-6![2,2,2-trifluoro-1-[4'-(methylsulphonyl)biphenyl-4-yl]ethane-1,1-diol structure](https://image.chemsrc.com/caspic/074/875272-88-1.png)
CAS#:875272-88-1This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethanone? |
| A: InChIKey of 2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethanone is RDBJQDMMWXAZRS-UHFFFAOYSA-N. |
| Q: What is the English name of 2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethanone? |
| A: The English name of 2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethanone is 2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethanone. |
| Q: What is the SMILES notation of 2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethanone? |
| A: SMILES notation of 2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethanone is CSc1ccc(-c2ccc(C(=O)C(F)(F)F)cc2)cc1. |
| Q: What are the downstream products of 2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethanone? |
| A: Related downstream products(CAS) of 2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethanone: 893407-18-6;875272-88-1. |
| Q: What is the Chinese name of 893407-15-3? |
| A: Chinese name of 893407-15-3 is 893407-15-3. |
| Q: What is the CAS number of 2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethanone? |
| A: CAS number of 2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethanone is 893407-15-3. |
| Q: What is the molecular formula of 2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethanone? |
| A: Molecular formula of 2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethanone is C15H11F3OS. |
| Q: What is the molecular weight of 2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethanone? |
| A: Molecular weight of 2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethanone is 296.30700. |
| Q: What is the LogP of 2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethanone? |
| A: LogP of 2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethanone is 4.82050. |
| Q: What is the polar surface area (PSA) of 2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethanone? |
| A: Polar surface area (PSA) of 2,2,2-trifluoro-1-[4-(4-methylsulfanylphenyl)phenyl]ethanone is 42.37000. |