acetic acid,2,3,4-trimethylpentan-3-ol structure
|
Common Name | acetic acid,2,3,4-trimethylpentan-3-ol | ||
|---|---|---|---|---|
| CAS Number | 89354-72-3 | Molecular Weight | 190.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | acetic acid,2,3,4-trimethylpentan-3-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H22O3 |
|---|---|
| Molecular Weight | 190.28000 |
| Exact Mass | 190.15700 |
| PSA | 57.53000 |
| LogP | 2.14030 |
| InChIKey | DBIGAPPHVGRLTI-UHFFFAOYSA-N |
| SMILES | CC(=O)O.CC(C)C(C)(O)C(C)C |
|
~%
acetic acid,2,3... CAS#:89354-72-3 |
| Literature: Louw, Robert; Vermeeren, Hans P.W.; Vogelzang, Martijn W. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1983 , # 12 p. 1875 - 1880 |
|
~%
acetic acid,2,3... CAS#:89354-72-3 |
| Literature: Louw, Robert; Vermeeren, Hans P.W.; Vogelzang, Martijn W. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1983 , # 12 p. 1875 - 1880 |
| 3-Pentanol,2,3,4-trimethyl-,acetate |
| 1-isopropyl-1,2-dimethylpropyl acetate |