6'-BROMO-3-PHENYL-3,4,5,6-TETRAHYDRO-2H-[1,2']BIPYRAZINYL-3'-YLAMINE structure
|
Common Name | 6'-BROMO-3-PHENYL-3,4,5,6-TETRAHYDRO-2H-[1,2']BIPYRAZINYL-3'-YLAMINE | ||
|---|---|---|---|---|
| CAS Number | 893612-07-2 | Molecular Weight | 334.21400 | |
| Density | 1.473g/cm3 | Boiling Point | 514.1ºC at 760 mmHg | |
| Molecular Formula | C14H16BrN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.7ºC | |
| Name | 5-bromo-3-(3-phenylpiperazin-1-yl)pyrazin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.473g/cm3 |
|---|---|
| Boiling Point | 514.1ºC at 760 mmHg |
| Molecular Formula | C14H16BrN5 |
| Molecular Weight | 334.21400 |
| Flash Point | 264.7ºC |
| Exact Mass | 333.05900 |
| PSA | 67.07000 |
| LogP | 2.94720 |
| Index of Refraction | 1.646 |
| InChIKey | IQNZGGJWXBMSKX-UHFFFAOYSA-N |
| SMILES | Nc1ncc(Br)nc1N1CCNC(c2ccccc2)C1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Pyrazinamine,5-bromo-3-(3-phenyl-1-piperazinyl) |
| GL-0625 |
| 6'-Bromo-3-phenyl-3,4,5,6-tetrahydro-2H-[1,2']bipyrazinyl-3'-ylamine |