Ethyl1-(2,5-dichlorophenyl)-1H-imidazole-5-carboxylate structure
|
Common Name | Ethyl1-(2,5-dichlorophenyl)-1H-imidazole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 893615-95-7 | Molecular Weight | 285.12600 | |
| Density | 1.38g/cm3 | Boiling Point | 426.1ºC at 760 mmHg | |
| Molecular Formula | C12H10Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.5ºC | |
| Name | ethyl 3-(2,5-dichlorophenyl)imidazole-4-carboxylate |
|---|
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 426.1ºC at 760 mmHg |
| Molecular Formula | C12H10Cl2N2O2 |
| Molecular Weight | 285.12600 |
| Flash Point | 211.5ºC |
| Exact Mass | 284.01200 |
| PSA | 44.12000 |
| LogP | 3.35580 |
| Index of Refraction | 1.606 |
| InChIKey | DTSXCLBTLMFUNR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cncn1-c1cc(Cl)ccc1Cl |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |