methyl 5-(cyclohexylcarbamoyl)-2-hydroxybenzoate
methyl 5-(cyclohexylcarbamoyl)-2-hydroxybenzoate structure
|
Common Name | methyl 5-(cyclohexylcarbamoyl)-2-hydroxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 89366-36-9 | Molecular Weight | 277.31600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 5-(cyclohexylcarbamoyl)-2-hydroxybenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H19NO4 |
|---|---|
| Molecular Weight | 277.31600 |
| Exact Mass | 277.13100 |
| PSA | 79.12000 |
| LogP | 2.81610 |
| InChIKey | RMVFOCFVYWSABT-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(C(=O)NC2CCCCC2)ccc1O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~86%
methyl 5-(cyclo... CAS#:89366-36-9 |
| Literature: Bousquet, E.; Cecchetti, V.; Regis, M. de; Mannucci, E.; Orzalesi, G.; Volpato, I. Farmaco, Edizione Scientifica, 1984 , vol. 39, # 1 p. 1 - 15 |
|
~%
methyl 5-(cyclo... CAS#:89366-36-9 |
| Literature: Bousquet, E.; Cecchetti, V.; Regis, M. de; Mannucci, E.; Orzalesi, G.; Volpato, I. Farmaco, Edizione Scientifica, 1984 , vol. 39, # 1 p. 1 - 15 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of methyl 5-(cyclohexylcarbamoyl)-2-hydroxybenzoate? |
| A: Molecular formula of methyl 5-(cyclohexylcarbamoyl)-2-hydroxybenzoate is C15H19NO4. |
| Q: What is the SMILES notation of methyl 5-(cyclohexylcarbamoyl)-2-hydroxybenzoate? |
| A: SMILES notation of methyl 5-(cyclohexylcarbamoyl)-2-hydroxybenzoate is COC(=O)c1cc(C(=O)NC2CCCCC2)ccc1O. |
| Q: What is the LogP of methyl 5-(cyclohexylcarbamoyl)-2-hydroxybenzoate? |
| A: LogP of methyl 5-(cyclohexylcarbamoyl)-2-hydroxybenzoate is 2.81610. |
| Q: What are the upstream materials of methyl 5-(cyclohexylcarbamoyl)-2-hydroxybenzoate? |
| A: Related upstream materials(CAS) of methyl 5-(cyclohexylcarbamoyl)-2-hydroxybenzoate: 108-91-8;89366-33-6;41684-11-1. |
| Q: What is the InChIKey of methyl 5-(cyclohexylcarbamoyl)-2-hydroxybenzoate? |
| A: InChIKey of methyl 5-(cyclohexylcarbamoyl)-2-hydroxybenzoate is RMVFOCFVYWSABT-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 89366-36-9? |
| A: Chinese name of 89366-36-9 is 89366-36-9. |
| Q: What is the CAS number of methyl 5-(cyclohexylcarbamoyl)-2-hydroxybenzoate? |
| A: CAS number of methyl 5-(cyclohexylcarbamoyl)-2-hydroxybenzoate is 89366-36-9. |
| Q: What is the English name of methyl 5-(cyclohexylcarbamoyl)-2-hydroxybenzoate? |
| A: The English name of methyl 5-(cyclohexylcarbamoyl)-2-hydroxybenzoate is methyl 5-(cyclohexylcarbamoyl)-2-hydroxybenzoate. |
| Q: What is the polar surface area (PSA) of methyl 5-(cyclohexylcarbamoyl)-2-hydroxybenzoate? |
| A: Polar surface area (PSA) of methyl 5-(cyclohexylcarbamoyl)-2-hydroxybenzoate is 79.12000. |
| Q: What is the molecular weight of methyl 5-(cyclohexylcarbamoyl)-2-hydroxybenzoate? |
| A: Molecular weight of methyl 5-(cyclohexylcarbamoyl)-2-hydroxybenzoate is 277.31600. |