3,8-dihydroxy-1-methoxyanthracene-9,10-dione
3,8-dihydroxy-1-methoxyanthracene-9,10-dione structure
|
Common Name | 3,8-dihydroxy-1-methoxyanthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 89367-83-9 | Molecular Weight | 270.23700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,8-dihydroxy-1-methoxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H10O5 |
|---|---|
| Molecular Weight | 270.23700 |
| Exact Mass | 270.05300 |
| PSA | 83.83000 |
| LogP | 1.88180 |
| InChIKey | MKPXKUVNBNOJOI-UHFFFAOYSA-N |
| SMILES | COc1cc(O)cc2c1C(=O)c1c(O)cccc1C2=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3,8-dihydroxy-1... CAS#:89367-83-9 |
| Literature: Cameron, Donald W.; Feutrill, Geoffrey I.; Gamble, Glenn B.; Stavrakis, John Tetrahedron Letters, 1986 , vol. 27, # 41 p. 4999 - 5002 |
|
~%
3,8-dihydroxy-1... CAS#:89367-83-9 |
| Literature: Inamori; Kato; Kubo; Kamiki; Takemoto; Nomoto Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 12 p. 4543 - 4548 |
|
~%
3,8-dihydroxy-1... CAS#:89367-83-9 |
| Literature: Cameron, Donald W.; Feutrill, Geoffrey I.; Gamble, Glenn B.; Stavrakis, John Tetrahedron Letters, 1986 , vol. 27, # 41 p. 4999 - 5002 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 9,10-Anthracenedione,3,8-dihydroxy-1-methoxy |
| 3,8-dihydroxy-1-methoxy-9,10-anthraquinone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3,8-dihydroxy-1-methoxyanthracene-9,10-dione? |
| A: InChIKey of 3,8-dihydroxy-1-methoxyanthracene-9,10-dione is MKPXKUVNBNOJOI-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3,8-dihydroxy-1-methoxyanthracene-9,10-dione? |
| A: SMILES notation of 3,8-dihydroxy-1-methoxyanthracene-9,10-dione is COc1cc(O)cc2c1C(=O)c1c(O)cccc1C2=O. |
| Q: What is the molecular weight of 3,8-dihydroxy-1-methoxyanthracene-9,10-dione? |
| A: Molecular weight of 3,8-dihydroxy-1-methoxyanthracene-9,10-dione is 270.23700. |
| Q: What is the CAS number of 3,8-dihydroxy-1-methoxyanthracene-9,10-dione? |
| A: CAS number of 3,8-dihydroxy-1-methoxyanthracene-9,10-dione is 89367-83-9. |
| Q: What English synonyms does 3,8-dihydroxy-1-methoxyanthracene-9,10-dione have? |
| A: English synonyms of 3,8-dihydroxy-1-methoxyanthracene-9,10-dione: 9,10-Anthracenedione,3,8-dihydroxy-1-methoxy, 3,8-dihydroxy-1-methoxy-9,10-anthraquinone. |
| Q: What is the LogP of 3,8-dihydroxy-1-methoxyanthracene-9,10-dione? |
| A: LogP of 3,8-dihydroxy-1-methoxyanthracene-9,10-dione is 1.88180. |
| Q: What is the Chinese name of 89367-83-9? |
| A: Chinese name of 89367-83-9 is 89367-83-9. |
| Q: What is the English name of 3,8-dihydroxy-1-methoxyanthracene-9,10-dione? |
| A: The English name of 3,8-dihydroxy-1-methoxyanthracene-9,10-dione is 3,8-dihydroxy-1-methoxyanthracene-9,10-dione. |
| Q: What are the upstream materials of 3,8-dihydroxy-1-methoxyanthracene-9,10-dione? |
| A: Related upstream materials(CAS) of 3,8-dihydroxy-1-methoxyanthracene-9,10-dione: 108637-75-8;3774-64-9;108637-79-2. |
| Q: What is the polar surface area (PSA) of 3,8-dihydroxy-1-methoxyanthracene-9,10-dione? |
| A: Polar surface area (PSA) of 3,8-dihydroxy-1-methoxyanthracene-9,10-dione is 83.83000. |