3-(benzenesulfinyl)propyl-trimethylsilane
3-(benzenesulfinyl)propyl-trimethylsilane structure
|
Common Name | 3-(benzenesulfinyl)propyl-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 89373-04-6 | Molecular Weight | 240.43700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H20OSSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(benzenesulfinyl)propyl-trimethylsilane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H20OSSi |
|---|---|
| Molecular Weight | 240.43700 |
| Exact Mass | 240.10000 |
| PSA | 36.28000 |
| LogP | 4.38820 |
| InChIKey | JDJUAXZFRMMGFG-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CCCS(=O)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3-(benzenesulfi... CAS#:89373-04-6 |
| Literature: Hosomi, Akira; Inaba, Masahiro; Sakurai, Hideki Chemistry Letters, 1983 , p. 1763 - 1766 |
|
~%
3-(benzenesulfi... CAS#:89373-04-6 |
| Literature: Hosomi, Akira; Inaba, Masahiro; Sakurai, Hideki Chemistry Letters, 1983 , p. 1763 - 1766 |
|
~%
3-(benzenesulfi... CAS#:89373-04-6 |
| Literature: Hosomi, Akira; Inaba, Masahiro; Sakurai, Hideki Chemistry Letters, 1983 , p. 1763 - 1766 |
|
~%
3-(benzenesulfi... CAS#:89373-04-6 |
| Literature: Hosomi, Akira; Inaba, Masahiro; Sakurai, Hideki Chemistry Letters, 1983 , p. 1763 - 1766 |
|
~%
3-(benzenesulfi... CAS#:89373-04-6 |
| Literature: Hosomi, Akira; Inaba, Masahiro; Sakurai, Hideki Chemistry Letters, 1983 , p. 1763 - 1766 |
![[[3-(trimethylsilyl)propyl]thio]benzene structure](https://image.chemsrc.com/caspic/232/19185-59-2.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 6 | |
CAS#:89373-07-9
CAS#:89373-08-0![[3-(benzenesulfinyl)-5-methylhexyl]-trimethylsilane structure](https://image.chemsrc.com/caspic/428/89373-09-1.png)
CAS#:89373-09-1![[3-(benzenesulfinyl)-5-methylhex-5-enyl]-trimethylsilane structure](https://image.chemsrc.com/caspic/073/89373-10-4.png)
CAS#:89373-10-4![[3-(benzenesulfinyl)-4-phenylbutyl]-trimethylsilane structure](https://image.chemsrc.com/caspic/035/89373-11-5.png)
CAS#:89373-11-5![[3-(benzenesulfinyl)-4-(4-methylphenyl)butyl]-trimethylsilane structure](https://image.chemsrc.com/caspic/497/89373-12-6.png)
CAS#:89373-12-6This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 3-(benzenesulfinyl)propyl-trimethylsilane? |
| A: Related downstream products(CAS) of 3-(benzenesulfinyl)propyl-trimethylsilane: 89373-07-9;89373-08-0;89373-09-1;89373-10-4;89373-11-5;89373-12-6. |
| Q: What is the InChIKey of 3-(benzenesulfinyl)propyl-trimethylsilane? |
| A: InChIKey of 3-(benzenesulfinyl)propyl-trimethylsilane is JDJUAXZFRMMGFG-UHFFFAOYSA-N. |
| Q: What is the LogP of 3-(benzenesulfinyl)propyl-trimethylsilane? |
| A: LogP of 3-(benzenesulfinyl)propyl-trimethylsilane is 4.38820. |
| Q: What is the SMILES notation of 3-(benzenesulfinyl)propyl-trimethylsilane? |
| A: SMILES notation of 3-(benzenesulfinyl)propyl-trimethylsilane is C[Si](C)(C)CCCS(=O)c1ccccc1. |
| Q: What is the Chinese name of 89373-04-6? |
| A: Chinese name of 89373-04-6 is 89373-04-6. |
| Q: What is the English name of 3-(benzenesulfinyl)propyl-trimethylsilane? |
| A: The English name of 3-(benzenesulfinyl)propyl-trimethylsilane is 3-(benzenesulfinyl)propyl-trimethylsilane. |
| Q: What are the upstream materials of 3-(benzenesulfinyl)propyl-trimethylsilane? |
| A: Related upstream materials(CAS) of 3-(benzenesulfinyl)propyl-trimethylsilane: 10545-34-3;3111-52-2;108-98-5;762-72-1. |
| Q: What is the molecular formula of 3-(benzenesulfinyl)propyl-trimethylsilane? |
| A: Molecular formula of 3-(benzenesulfinyl)propyl-trimethylsilane is C12H20OSSi. |
| Q: What is the polar surface area (PSA) of 3-(benzenesulfinyl)propyl-trimethylsilane? |
| A: Polar surface area (PSA) of 3-(benzenesulfinyl)propyl-trimethylsilane is 36.28000. |
| Q: What is the CAS number of 3-(benzenesulfinyl)propyl-trimethylsilane? |
| A: CAS number of 3-(benzenesulfinyl)propyl-trimethylsilane is 89373-04-6. |