spiro[1,3-diazinane-5,13'-2,3,4,11b-tetrahydrophthalazino[2,1-a][3,1]benzoxazine]-1',2,4,6-tetrone structure
|
Common Name | spiro[1,3-diazinane-5,13'-2,3,4,11b-tetrahydrophthalazino[2,1-a][3,1]benzoxazine]-1',2,4,6-tetrone | ||
|---|---|---|---|---|
| CAS Number | 89376-99-8 | Molecular Weight | 366.32800 | |
| Density | 1.78g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H14N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | spiro[1,3-diazinane-5,13'-2,3,4,11b-tetrahydrophthalazino[2,1-a][3,1]benzoxazine]-1',2,4,6-tetrone |
|---|
| Density | 1.78g/cm3 |
|---|---|
| Molecular Formula | C18H14N4O5 |
| Molecular Weight | 366.32800 |
| Exact Mass | 366.09600 |
| PSA | 117.17000 |
| LogP | 0.50790 |
| Index of Refraction | 1.841 |
| InChIKey | WVSCLCFUDGMUOW-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C2(OC3c4ccccc4C=NN3C3=C2C(=O)CCC3)C(=O)N1 |
|
~82%
spiro[1,3-diazi... CAS#:89376-99-8 |
| Literature: Altomare, C.; Carotti, A.; Campagna, F. Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 1751 - 1752 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |