methyl 3-hydroxy-5-nitrothiophene-2-carboxylate structure
|
Common Name | methyl 3-hydroxy-5-nitrothiophene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 89380-77-8 | Molecular Weight | 203.17300 | |
| Density | 1.599 g/cm3 | Boiling Point | 329.379ºC at 760 mmHg | |
| Molecular Formula | C6H5NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.003°C | |
| Name | methyl 3-hydroxy-5-nitrothiophene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.599 g/cm3 |
|---|---|
| Boiling Point | 329.379ºC at 760 mmHg |
| Molecular Formula | C6H5NO5S |
| Molecular Weight | 203.17300 |
| Flash Point | 153.003°C |
| Exact Mass | 202.98900 |
| PSA | 120.59000 |
| LogP | 1.67170 |
| Index of Refraction | 1.623 |
| InChIKey | CJHDSFKNSOHWCK-UHFFFAOYSA-N |
| SMILES | COC(=O)c1sc([N+](=O)[O-])cc1O |
| HS Code | 2934999090 |
|---|
|
~40%
methyl 3-hydrox... CAS#:89380-77-8 |
| Literature: Journal of Chemical Research, Miniprint, , # 10 p. 1001 - 1023 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 3-hydroxy-5-nitro-2-thiophenecarboxylate |
| methyl 3-hydroxy-5-nitrothiothiophene-2-carboxylate |