2,2-Difluoro-N,N,N',N'-tetramethylmalonamide
Modify Date: 2025-09-21 19:37:57
2,2-Difluoro-N,N,N',N'-tetramethylmalonamide structure
|
Common Name | 2,2-Difluoro-N,N,N',N'-tetramethylmalonamide | ||
|---|---|---|---|---|
| CAS Number | 894073-30-4 | Molecular Weight | 194.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H12F2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2-Difluoro-N,N,N',N'-tetramethylmalonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H12F2N2O2 |
|---|---|
| Molecular Weight | 194.18 |
| InChIKey | XPDRRQILTMVSPT-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C(F)(F)C(=O)N(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2,2-Difluoro-N,N,N',N'-tetramethylmalonamide? |
| A: Molecular weight of 2,2-Difluoro-N,N,N',N'-tetramethylmalonamide is 194.18. |
| Q: What is the English name of 2,2-Difluoro-N,N,N',N'-tetramethylmalonamide? |
| A: The English name of 2,2-Difluoro-N,N,N',N'-tetramethylmalonamide is 2,2-Difluoro-N,N,N',N'-tetramethylmalonamide. |
| Q: What is the CAS number of 2,2-Difluoro-N,N,N',N'-tetramethylmalonamide? |
| A: CAS number of 2,2-Difluoro-N,N,N',N'-tetramethylmalonamide is 894073-30-4. |
| Q: What is the Chinese name of 894073-30-4? |
| A: Chinese name of 894073-30-4 is 894073-30-4. |
| Q: What is the InChIKey of 2,2-Difluoro-N,N,N',N'-tetramethylmalonamide? |
| A: InChIKey of 2,2-Difluoro-N,N,N',N'-tetramethylmalonamide is XPDRRQILTMVSPT-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2,2-Difluoro-N,N,N',N'-tetramethylmalonamide? |
| A: Molecular formula of 2,2-Difluoro-N,N,N',N'-tetramethylmalonamide is C7H12F2N2O2. |
| Q: What is the SMILES notation of 2,2-Difluoro-N,N,N',N'-tetramethylmalonamide? |
| A: SMILES notation of 2,2-Difluoro-N,N,N',N'-tetramethylmalonamide is CN(C)C(=O)C(F)(F)C(=O)N(C)C. |