nitramide
nitramide structure
|
Common Name | nitramide | ||
|---|---|---|---|---|
| CAS Number | 89415-63-4 | Molecular Weight | 543.98200 | |
| Density | 2.218g/cm3 | Boiling Point | 630.4ºC at 760 mmHg | |
| Molecular Formula | C6H8Br2N8O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 335ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,8-diazabicyclo[5.4.0]undec-7-ene phenol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 2.218g/cm3 |
|---|---|
| Boiling Point | 630.4ºC at 760 mmHg |
| Molecular Formula | C6H8Br2N8O12 |
| Molecular Weight | 543.98200 |
| Flash Point | 335ºC |
| Exact Mass | 541.86300 |
| PSA | 281.40000 |
| LogP | 2.31720 |
| Index of Refraction | 1.644 |
| InChIKey | RIOYVMCZLHXDRJ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])N(CCN(CC(Br)([N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])CC(Br)([N+](=O)[O-])[N+](=O)[O-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
nitramide CAS#:89415-63-4 |
| Literature: Winters,L.J.; McEwen,W.E. Tetrahedron, Supplement, 1963 , vol. 4, p. 49 - 56 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Phenol,compd. with 2,3,4,6,7,8,9,10-octahydropyrimido(1,2-a)azepine (1:1) |
| 1,8-Dibrom-1,1,3,6,8,8-hexanitro-3,6-diaza-octan |
| 1,8-diaza-spiro[4.6]undecane-1-carboxylic acid tert-butyl ester |
| 1,8-Diazabicyclo[5.4.0]undec-7-ene,compound with phenol (1:1) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1,8-diazabicyclo[5.4.0]undec-7-ene phenol? |
| A: Molecular weight of 1,8-diazabicyclo[5.4.0]undec-7-ene phenol is 543.98200. |
| Q: What is the LogP of 1,8-diazabicyclo[5.4.0]undec-7-ene phenol? |
| A: LogP of 1,8-diazabicyclo[5.4.0]undec-7-ene phenol is 2.31720. |
| Q: What is the CAS number of 1,8-diazabicyclo[5.4.0]undec-7-ene phenol? |
| A: CAS number of 1,8-diazabicyclo[5.4.0]undec-7-ene phenol is 89415-63-4. |
| Q: What is the Chinese name of 89415-63-4? |
| A: Chinese name of 89415-63-4 is 89415-63-4. |
| Q: What is the English name of 1,8-diazabicyclo[5.4.0]undec-7-ene phenol? |
| A: The English name of 1,8-diazabicyclo[5.4.0]undec-7-ene phenol is 1,8-diazabicyclo[5.4.0]undec-7-ene phenol. |
| Q: What is the InChIKey of 1,8-diazabicyclo[5.4.0]undec-7-ene phenol? |
| A: InChIKey of 1,8-diazabicyclo[5.4.0]undec-7-ene phenol is RIOYVMCZLHXDRJ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1,8-diazabicyclo[5.4.0]undec-7-ene phenol? |
| A: SMILES notation of 1,8-diazabicyclo[5.4.0]undec-7-ene phenol is O=[N+]([O-])N(CCN(CC(Br)([N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])CC(Br)([N+](=O)[O-])[N+](=O)[O-]. |
| Q: What is the polar surface area (PSA) of 1,8-diazabicyclo[5.4.0]undec-7-ene phenol? |
| A: Polar surface area (PSA) of 1,8-diazabicyclo[5.4.0]undec-7-ene phenol is 281.40000. |
| Q: What is the boiling point of 1,8-diazabicyclo[5.4.0]undec-7-ene phenol? |
| A: Boiling point of 1,8-diazabicyclo[5.4.0]undec-7-ene phenol is 630.4ºC at 760 mmHg. |
| Q: What are the upstream materials of 1,8-diazabicyclo[5.4.0]undec-7-ene phenol? |
| A: Related upstream materials(CAS) of 1,8-diazabicyclo[5.4.0]undec-7-ene phenol: 505-71-5;5917-59-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |