nitramide
Modify Date: 2025-09-21 11:09:29
nitramide structure
|
Common Name | nitramide | ||
|---|---|---|---|---|
| CAS Number | 89415-63-4 | Molecular Weight | 543.98200 | |
| Density | 2.218g/cm3 | Boiling Point | 630.4ºC at 760 mmHg | |
| Molecular Formula | C6H8Br2N8O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 335ºC | |
| Name | 1,8-diazabicyclo[5.4.0]undec-7-ene phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 2.218g/cm3 |
|---|---|
| Boiling Point | 630.4ºC at 760 mmHg |
| Molecular Formula | C6H8Br2N8O12 |
| Molecular Weight | 543.98200 |
| Flash Point | 335ºC |
| Exact Mass | 541.86300 |
| PSA | 281.40000 |
| LogP | 2.31720 |
| Index of Refraction | 1.644 |
| InChIKey | RIOYVMCZLHXDRJ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])N(CCN(CC(Br)([N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])CC(Br)([N+](=O)[O-])[N+](=O)[O-] |
|
~%
nitramide CAS#:89415-63-4 |
| Literature: Winters,L.J.; McEwen,W.E. Tetrahedron, Supplement, 1963 , vol. 4, p. 49 - 56 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1
| Phenol,compd. with 2,3,4,6,7,8,9,10-octahydropyrimido(1,2-a)azepine (1:1) |
| 1,8-Dibrom-1,1,3,6,8,8-hexanitro-3,6-diaza-octan |
| 1,8-diaza-spiro[4.6]undecane-1-carboxylic acid tert-butyl ester |
| 1,8-Diazabicyclo[5.4.0]undec-7-ene,compound with phenol (1:1) |