3-(2,2,5,5-tetramethyl-3-oxopyrrolidin-1-yl)prop-2-enenitrile structure
|
Common Name | 3-(2,2,5,5-tetramethyl-3-oxopyrrolidin-1-yl)prop-2-enenitrile | ||
|---|---|---|---|---|
| CAS Number | 89422-23-1 | Molecular Weight | 192.25800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(2,2,5,5-tetramethyl-3-oxopyrrolidin-1-yl)prop-2-enenitrile |
|---|
| Molecular Formula | C11H16N2O |
|---|---|
| Molecular Weight | 192.25800 |
| Exact Mass | 192.12600 |
| PSA | 44.10000 |
| LogP | 1.79358 |
| InChIKey | SPGZCJKCXFAUOH-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)C(C)(C)N1C=CC#N |
|
~37%
3-(2,2,5,5-tetr... CAS#:89422-23-1 |
| Literature: Kostyanovskii, R. G.; El'natanov, Yu. I. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1983 , vol. 32, # 11 p. 2322 - 2332 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1983 , # 11 p. 2581 - 2592 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |