3-oxo-3-(2-trifluoromethylphenyl)propionic acid ethyl ester structure
|
Common Name | 3-oxo-3-(2-trifluoromethylphenyl)propionic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 89424-17-9 | Molecular Weight | 260.20900 | |
| Density | 1.258 g/mL at 25ºC(lit.) | Boiling Point | 237-238ºC(lit.) | |
| Molecular Formula | C12H11F3O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Name | ethyl 3-oxo-3-[2-(trifluoromethyl)phenyl]propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.258 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 237-238ºC(lit.) |
| Molecular Formula | C12H11F3O3 |
| Molecular Weight | 260.20900 |
| Flash Point | >230 °F |
| Exact Mass | 260.06600 |
| PSA | 43.37000 |
| LogP | 2.84130 |
| Index of Refraction | n20/D 1.4875(lit.) |
| InChIKey | KMPAHDWULITWIH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1ccccc1C(F)(F)F |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918300090 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| methyl 2-trifluoromethylbenzoylacetate |
| MFCD03424820 |