2,4-dimethyl-5-[(4-methylpiperazin-1-yl)methyl]benzaldehyde structure
|
Common Name | 2,4-dimethyl-5-[(4-methylpiperazin-1-yl)methyl]benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 894370-26-4 | Molecular Weight | 246.34800 | |
| Density | 1.066g/cm3 | Boiling Point | 368.6ºC at 760 mmHg | |
| Molecular Formula | C15H22N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150ºC | |
| Name | 2,4-dimethyl-5-[(4-methylpiperazin-1-yl)methyl]benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.066g/cm3 |
|---|---|
| Boiling Point | 368.6ºC at 760 mmHg |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.34800 |
| Flash Point | 150ºC |
| Exact Mass | 246.17300 |
| PSA | 23.55000 |
| LogP | 1.73910 |
| Index of Refraction | 1.57 |
| InChIKey | WTPRFYCTSCXCPW-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(CN2CCN(C)CC2)cc1C=O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,4-di-tert-butylphenol |