3-[(4-ethylpiperazin-1-yl)methyl]-2,5-dimethylbenzaldehyde
Modify Date: 2025-09-14 11:54:22
![3-[(4-ethylpiperazin-1-yl)methyl]-2,5-dimethylbenzaldehyde Structure](https://image.chemsrc.com/caspic/112/894370-38-8.png)
3-[(4-ethylpiperazin-1-yl)methyl]-2,5-dimethylbenzaldehyde structure
|
Common Name | 3-[(4-ethylpiperazin-1-yl)methyl]-2,5-dimethylbenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 894370-38-8 | Molecular Weight | 260.37500 | |
| Density | 1.047g/cm3 | Boiling Point | 380.2ºC at 760 mmHg | |
| Molecular Formula | C16H24N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.1ºC | |
| Name | 3-[(4-ethylpiperazin-1-yl)methyl]-2,5-dimethylbenzaldehyde |
|---|
| Density | 1.047g/cm3 |
|---|---|
| Boiling Point | 380.2ºC at 760 mmHg |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.37500 |
| Flash Point | 152.1ºC |
| Exact Mass | 260.18900 |
| PSA | 23.55000 |
| LogP | 2.12920 |
| Index of Refraction | 1.56 |
| InChIKey | UBRQZGDMKHLFNE-UHFFFAOYSA-N |
| SMILES | CCN1CCN(Cc2cc(C)cc(C=O)c2C)CC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |