5-[(4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine structure
|
Common Name | 5-[(4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 89445-87-4 | Molecular Weight | 265.31300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[(4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine |
|---|
| Molecular Formula | C15H15N5 |
|---|---|
| Molecular Weight | 265.31300 |
| Exact Mass | 265.13300 |
| PSA | 92.17000 |
| LogP | 1.94860 |
| InChIKey | WHLMSTTWJMOYPJ-UHFFFAOYSA-N |
| SMILES | Cc1ccnc2ccc(Cc3cnc(N)nc3N)cc12 |
|
~16%
5-[(4-methylqui... CAS#:89445-87-4 |
| Literature: Rauckman; Tidwell; Johnson; Roth Journal of Medicinal Chemistry, 1989 , vol. 32, # 8 p. 1927 - 1935 |
|
~%
5-[(4-methylqui... CAS#:89445-87-4 |
| Literature: Rauckman; Tidwell; Johnson; Roth Journal of Medicinal Chemistry, 1989 , vol. 32, # 8 p. 1927 - 1935 |
|
~%
5-[(4-methylqui... CAS#:89445-87-4 |
| Literature: Rauckman; Tidwell; Johnson; Roth Journal of Medicinal Chemistry, 1989 , vol. 32, # 8 p. 1927 - 1935 |
|
~%
5-[(4-methylqui... CAS#:89445-87-4 |
| Literature: Rauckman; Tidwell; Johnson; Roth Journal of Medicinal Chemistry, 1989 , vol. 32, # 8 p. 1927 - 1935 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |