5-[(8-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine
![5-[(8-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine Structure](https://image.chemsrc.com/caspic/027/89446-00-4.png)
5-[(8-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine structure
|
Common Name | 5-[(8-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 89446-00-4 | Molecular Weight | 280.32800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-[(8-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H16N6 |
|---|---|
| Molecular Weight | 280.32800 |
| Exact Mass | 280.14400 |
| PSA | 118.19000 |
| LogP | 2.11200 |
| InChIKey | KQQMBGTVDPCLIU-UHFFFAOYSA-N |
| SMILES | Cc1ccnc2c(N)cc(Cc3cnc(N)nc3N)cc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
5-[(8-amino-4-m... CAS#:89446-00-4 |
| Literature: Burroughs Wellcome Co. Patent: US4587341 A1, 1986 ; |
![5-[[8-(2-methoxyethoxy)quinolin-6-yl]methyl]pyrimidine-2,4-diamine structure](https://image.chemsrc.com/caspic/007/89445-85-2.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 5-[(8-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine? |
| A: The English name of 5-[(8-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine is 5-[(8-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine. |
| Q: What is the molecular formula of 5-[(8-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine? |
| A: Molecular formula of 5-[(8-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine is C15H16N6. |
| Q: What are the upstream materials of 5-[(8-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine? |
| A: Related upstream materials(CAS) of 5-[(8-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine: 89445-85-2. |
| Q: What is the InChIKey of 5-[(8-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine? |
| A: InChIKey of 5-[(8-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine is KQQMBGTVDPCLIU-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 5-[(8-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine? |
| A: Polar surface area (PSA) of 5-[(8-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine is 118.19000. |
| Q: What is the SMILES notation of 5-[(8-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine? |
| A: SMILES notation of 5-[(8-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine is Cc1ccnc2c(N)cc(Cc3cnc(N)nc3N)cc12. |
| Q: What is the CAS number of 5-[(8-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine? |
| A: CAS number of 5-[(8-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine is 89446-00-4. |
| Q: What is the LogP of 5-[(8-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine? |
| A: LogP of 5-[(8-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine is 2.11200. |
| Q: What is the molecular weight of 5-[(8-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine? |
| A: Molecular weight of 5-[(8-amino-4-methylquinolin-6-yl)methyl]pyrimidine-2,4-diamine is 280.32800. |
| Q: What is the Chinese name of 89446-00-4? |
| A: Chinese name of 89446-00-4 is 89446-00-4. |