6-bromo-4,8-dimethyl-1H-quinolin-2-one
6-bromo-4,8-dimethyl-1H-quinolin-2-one structure
|
Common Name | 6-bromo-4,8-dimethyl-1H-quinolin-2-one | ||
|---|---|---|---|---|
| CAS Number | 89446-45-7 | Molecular Weight | 252.10700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-bromo-4,8-dimethyl-1H-quinolin-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H10BrNO |
|---|---|
| Molecular Weight | 252.10700 |
| Exact Mass | 250.99500 |
| PSA | 33.12000 |
| LogP | 3.31970 |
| InChIKey | PSQCYNBBHLNTDR-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)[nH]c2c(C)cc(Br)cc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~62%
6-bromo-4,8-dim... CAS#:89446-45-7 |
| Literature: Davis, Steven E.; Rauckman, Barbara S.; Chan, Joseph H.; Roth, Barbara Journal of Medicinal Chemistry, 1989 , vol. 32, # 8 p. 1936 - 1942 |
|
~%
6-bromo-4,8-dim... CAS#:89446-45-7 |
| Literature: Davis, Steven E.; Rauckman, Barbara S.; Chan, Joseph H.; Roth, Barbara Journal of Medicinal Chemistry, 1989 , vol. 32, # 8 p. 1936 - 1942 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 4 | |
CAS#:89446-46-8
CAS#:99455-14-8
CAS#:89446-47-9
CAS#:89446-48-0This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 6-bromo-4,8-dimethyl-1H-quinolin-2-one? |
| A: Related upstream materials(CAS) of 6-bromo-4,8-dimethyl-1H-quinolin-2-one: 23939-48-2;583-75-5. |
| Q: What is the molecular weight of 6-bromo-4,8-dimethyl-1H-quinolin-2-one? |
| A: Molecular weight of 6-bromo-4,8-dimethyl-1H-quinolin-2-one is 252.10700. |
| Q: What is the polar surface area (PSA) of 6-bromo-4,8-dimethyl-1H-quinolin-2-one? |
| A: Polar surface area (PSA) of 6-bromo-4,8-dimethyl-1H-quinolin-2-one is 33.12000. |
| Q: What is the CAS number of 6-bromo-4,8-dimethyl-1H-quinolin-2-one? |
| A: CAS number of 6-bromo-4,8-dimethyl-1H-quinolin-2-one is 89446-45-7. |
| Q: What is the SMILES notation of 6-bromo-4,8-dimethyl-1H-quinolin-2-one? |
| A: SMILES notation of 6-bromo-4,8-dimethyl-1H-quinolin-2-one is Cc1cc(=O)[nH]c2c(C)cc(Br)cc12. |
| Q: What is the Chinese name of 89446-45-7? |
| A: Chinese name of 89446-45-7 is 89446-45-7. |
| Q: What is the LogP of 6-bromo-4,8-dimethyl-1H-quinolin-2-one? |
| A: LogP of 6-bromo-4,8-dimethyl-1H-quinolin-2-one is 3.31970. |
| Q: What is the molecular formula of 6-bromo-4,8-dimethyl-1H-quinolin-2-one? |
| A: Molecular formula of 6-bromo-4,8-dimethyl-1H-quinolin-2-one is C11H10BrNO. |
| Q: What is the English name of 6-bromo-4,8-dimethyl-1H-quinolin-2-one? |
| A: The English name of 6-bromo-4,8-dimethyl-1H-quinolin-2-one is 6-bromo-4,8-dimethyl-1H-quinolin-2-one. |
| Q: What are the downstream products of 6-bromo-4,8-dimethyl-1H-quinolin-2-one? |
| A: Related downstream products(CAS) of 6-bromo-4,8-dimethyl-1H-quinolin-2-one: 89446-46-8;99455-14-8;89446-47-9;89446-48-0. |