acetic acid,4-chloro-5,8-dimethoxynaphthalen-1-ol
acetic acid,4-chloro-5,8-dimethoxynaphthalen-1-ol structure
|
Common Name | acetic acid,4-chloro-5,8-dimethoxynaphthalen-1-ol | ||
|---|---|---|---|---|
| CAS Number | 89474-96-4 | Molecular Weight | 298.71900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15ClO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | acetic acid,4-chloro-5,8-dimethoxynaphthalen-1-ol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H15ClO5 |
|---|---|
| Molecular Weight | 298.71900 |
| Exact Mass | 298.06100 |
| PSA | 75.99000 |
| LogP | 3.30690 |
| InChIKey | XJFDWNYJRQQFSP-UHFFFAOYSA-N |
| SMILES | CC(=O)O.COc1ccc(OC)c2c(Cl)ccc(O)c12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
acetic acid,4-c... CAS#:89474-96-4 |
| Literature: Laatsch, Hartmut Liebigs Annalen der Chemie, 1984 , # 2 p. 319 - 339 |
|
~%
acetic acid,4-c... CAS#:89474-96-4 |
| Literature: Laatsch, Hartmut Liebigs Annalen der Chemie, 1984 , # 2 p. 319 - 339 |
|
~%
acetic acid,4-c... CAS#:89474-96-4 |
| Literature: Laatsch, Hartmut Liebigs Annalen der Chemie, 1984 , # 2 p. 319 - 339 |
|
~%
acetic acid,4-c... CAS#:89474-96-4 |
| Literature: Laatsch, Hartmut Liebigs Annalen der Chemie, 1984 , # 2 p. 319 - 339 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Acetoxy-4-chlor-5,8-dimethoxynaphthalin |
| 1-Naphthalenol,4-chloro-5,8-dimethoxy-,acetate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of acetic acid,4-chloro-5,8-dimethoxynaphthalen-1-ol? |
| A: LogP of acetic acid,4-chloro-5,8-dimethoxynaphthalen-1-ol is 3.30690. |
| Q: What is the English name of acetic acid,4-chloro-5,8-dimethoxynaphthalen-1-ol? |
| A: The English name of acetic acid,4-chloro-5,8-dimethoxynaphthalen-1-ol is acetic acid,4-chloro-5,8-dimethoxynaphthalen-1-ol. |
| Q: What is the CAS number of acetic acid,4-chloro-5,8-dimethoxynaphthalen-1-ol? |
| A: CAS number of acetic acid,4-chloro-5,8-dimethoxynaphthalen-1-ol is 89474-96-4. |
| Q: What is the polar surface area (PSA) of acetic acid,4-chloro-5,8-dimethoxynaphthalen-1-ol? |
| A: Polar surface area (PSA) of acetic acid,4-chloro-5,8-dimethoxynaphthalen-1-ol is 75.99000. |
| Q: What is the molecular formula of acetic acid,4-chloro-5,8-dimethoxynaphthalen-1-ol? |
| A: Molecular formula of acetic acid,4-chloro-5,8-dimethoxynaphthalen-1-ol is C14H15ClO5. |
| Q: What is the SMILES notation of acetic acid,4-chloro-5,8-dimethoxynaphthalen-1-ol? |
| A: SMILES notation of acetic acid,4-chloro-5,8-dimethoxynaphthalen-1-ol is CC(=O)O.COc1ccc(OC)c2c(Cl)ccc(O)c12. |
| Q: What English synonyms does acetic acid,4-chloro-5,8-dimethoxynaphthalen-1-ol have? |
| A: English synonyms of acetic acid,4-chloro-5,8-dimethoxynaphthalen-1-ol: 1-Acetoxy-4-chlor-5,8-dimethoxynaphthalin, 1-Naphthalenol,4-chloro-5,8-dimethoxy-,acetate. |
| Q: What is the Chinese name of 89474-96-4? |
| A: Chinese name of 89474-96-4 is 89474-96-4. |
| Q: What is the InChIKey of acetic acid,4-chloro-5,8-dimethoxynaphthalen-1-ol? |
| A: InChIKey of acetic acid,4-chloro-5,8-dimethoxynaphthalen-1-ol is XJFDWNYJRQQFSP-UHFFFAOYSA-N. |
| Q: What are the upstream materials of acetic acid,4-chloro-5,8-dimethoxynaphthalen-1-ol? |
| A: Related upstream materials(CAS) of acetic acid,4-chloro-5,8-dimethoxynaphthalen-1-ol: 52431-59-1;89474-89-5;106-48-9;89474-91-9. |