Carbamimidothioic acid,N-[[(4-chlorophenyl)amino]thioxomethyl]-N'-ethyl-, ethyl ester structure
|
Common Name | Carbamimidothioic acid,N-[[(4-chlorophenyl)amino]thioxomethyl]-N'-ethyl-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 89477-60-1 | Molecular Weight | 301.85900 | |
| Density | 1.24g/cm3 | Boiling Point | 404.4ºC at 760 mmHg | |
| Molecular Formula | C12H16ClN3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.4ºC | |
| Name | ethyl N-[(4-chlorophenyl)carbamothioyl]-N'-ethylcarbamimidothioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 404.4ºC at 760 mmHg |
| Molecular Formula | C12H16ClN3S2 |
| Molecular Weight | 301.85900 |
| Flash Point | 198.4ºC |
| Exact Mass | 301.04700 |
| PSA | 93.81000 |
| LogP | 4.21930 |
| Index of Refraction | 1.608 |
| InChIKey | IUTIBNGFVGXBHT-UHFFFAOYSA-N |
| SMILES | CCN=C(NC(=S)Nc1ccc(Cl)cc1)SCC |
|
~%
Carbamimidothio... CAS#:89477-60-1 |
| Literature: Curd et al. Journal of the Chemical Society, 1949 , p. 1739,1742 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| N,S-Diaethyl-N'-(4-chlor-phenylthiocarbamoyl)-isothioharnstoff |
| N,S-diethyl-N'-(4-chloro-phenylthiocarbamoyl)-isothiourea |