2-bromo-3-(4-methylphenyl)sulfanyl-naphthalene-1,4-dione
2-bromo-3-(4-methylphenyl)sulfanyl-naphthalene-1,4-dione structure
|
Common Name | 2-bromo-3-(4-methylphenyl)sulfanyl-naphthalene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 89478-07-9 | Molecular Weight | 359.23700 | |
| Density | 1.58g/cm3 | Boiling Point | 441.9ºC at 760 mmHg | |
| Molecular Formula | C17H11BrO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Brom-3-p-tolylmercapto-[1,4]naphthochinon |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 441.9ºC at 760 mmHg |
| Molecular Formula | C17H11BrO2S |
| Molecular Weight | 359.23700 |
| Flash Point | 221ºC |
| Exact Mass | 357.96600 |
| PSA | 59.44000 |
| LogP | 4.77280 |
| Index of Refraction | 1.703 |
| InChIKey | HAMSJFSQFUEGCQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(SC2=C(Br)C(=O)c3ccccc3C2=O)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-bromo-3-(4-me... CAS#:89478-07-9 |
| Literature: Miyaki; Ikeda Yakugaku Zasshi, 1953 , vol. 73, p. 964,967 Chem.Abstr., 1954 , p. 10702 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Brom-3-phthalimido-propionsaeure |
| 2-bromo-3-phthalimido-propionic acid |
| 2-bromo-3-p-tolylsulfanyl-[1,4]naphthoquinone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-Brom-3-p-tolylmercapto-[1,4]naphthochinon? |
| A: CAS number of 2-Brom-3-p-tolylmercapto-[1,4]naphthochinon is 89478-07-9. |
| Q: What is the molecular weight of 2-Brom-3-p-tolylmercapto-[1,4]naphthochinon? |
| A: Molecular weight of 2-Brom-3-p-tolylmercapto-[1,4]naphthochinon is 359.23700. |
| Q: What English synonyms does 2-Brom-3-p-tolylmercapto-[1,4]naphthochinon have? |
| A: English synonyms of 2-Brom-3-p-tolylmercapto-[1,4]naphthochinon: 2-Brom-3-phthalimido-propionsaeure, 2-bromo-3-phthalimido-propionic acid, 2-bromo-3-p-tolylsulfanyl-[1,4]naphthoquinone. |
| Q: What is the English name of 2-Brom-3-p-tolylmercapto-[1,4]naphthochinon? |
| A: The English name of 2-Brom-3-p-tolylmercapto-[1,4]naphthochinon is 2-Brom-3-p-tolylmercapto-[1,4]naphthochinon. |
| Q: What is the molecular formula of 2-Brom-3-p-tolylmercapto-[1,4]naphthochinon? |
| A: Molecular formula of 2-Brom-3-p-tolylmercapto-[1,4]naphthochinon is C17H11BrO2S. |
| Q: What is the boiling point of 2-Brom-3-p-tolylmercapto-[1,4]naphthochinon? |
| A: Boiling point of 2-Brom-3-p-tolylmercapto-[1,4]naphthochinon is 441.9ºC at 760 mmHg. |
| Q: What are the upstream materials of 2-Brom-3-p-tolylmercapto-[1,4]naphthochinon? |
| A: Related upstream materials(CAS) of 2-Brom-3-p-tolylmercapto-[1,4]naphthochinon: 89478-03-5. |
| Q: What is the polar surface area (PSA) of 2-Brom-3-p-tolylmercapto-[1,4]naphthochinon? |
| A: Polar surface area (PSA) of 2-Brom-3-p-tolylmercapto-[1,4]naphthochinon is 59.44000. |
| Q: What is the SMILES notation of 2-Brom-3-p-tolylmercapto-[1,4]naphthochinon? |
| A: SMILES notation of 2-Brom-3-p-tolylmercapto-[1,4]naphthochinon is Cc1ccc(SC2=C(Br)C(=O)c3ccccc3C2=O)cc1. |
| Q: What is the InChIKey of 2-Brom-3-p-tolylmercapto-[1,4]naphthochinon? |
| A: InChIKey of 2-Brom-3-p-tolylmercapto-[1,4]naphthochinon is HAMSJFSQFUEGCQ-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |