1-(4,6-diphenylpyridine-2-carbonyl)-5-methylpyridin-2-one structure
|
Common Name | 1-(4,6-diphenylpyridine-2-carbonyl)-5-methylpyridin-2-one | ||
|---|---|---|---|---|
| CAS Number | 89478-71-7 | Molecular Weight | 366.41200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4,6-diphenylpyridine-2-carbonyl)-5-methylpyridin-2-one |
|---|
| Molecular Formula | C24H18N2O2 |
|---|---|
| Molecular Weight | 366.41200 |
| Exact Mass | 366.13700 |
| PSA | 51.96000 |
| LogP | 4.57420 |
| InChIKey | ODLQUVXVHSJZBH-UHFFFAOYSA-N |
| SMILES | Cc1ccc(=O)n(C(=O)c2cc(-c3ccccc3)cc(-c3ccccc3)n2)c1 |
|
~%
1-(4,6-diphenyl... CAS#:89478-71-7 |
| Literature: Katritzky, Alan R.; Awartani, Radi Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 11 p. 2623 - 2627 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |