3-ethoxy-2-hydroxy-2-prop-2-enylnaphthalen-1-one structure
|
Common Name | 3-ethoxy-2-hydroxy-2-prop-2-enylnaphthalen-1-one | ||
|---|---|---|---|---|
| CAS Number | 89510-10-1 | Molecular Weight | 244.28600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-ethoxy-2-hydroxy-2-prop-2-enylnaphthalen-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H16O3 |
|---|---|
| Molecular Weight | 244.28600 |
| Exact Mass | 244.11000 |
| PSA | 46.53000 |
| LogP | 2.56750 |
| InChIKey | IKSGGABCTUYTMS-UHFFFAOYSA-N |
| SMILES | C=CCC1(O)C(=O)c2ccccc2C=C1OCC |
|
~88%
3-ethoxy-2-hydr... CAS#:89510-10-1 |
| Literature: Takuwa, Akio; Naruta, Yoshinori; Soga, Osamu; Maruyama, Kazuhiro Journal of Organic Chemistry, 1984 , vol. 49, # 11 p. 1857 - 1864 |
|
~%
3-ethoxy-2-hydr... CAS#:89510-10-1 |
| Literature: Takuwa, Akio; Naruta, Yoshinori; Soga, Osamu; Maruyama, Kazuhiro Journal of Organic Chemistry, 1984 , vol. 49, # 11 p. 1857 - 1864 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2-allyl-5,6-benzo-2-hydroxy-3-ethoxycyclohex-3-en-1-one |