3-methoxy-4-(3-methylbut-2-enyl)naphthalene-1,2-dione structure
|
Common Name | 3-methoxy-4-(3-methylbut-2-enyl)naphthalene-1,2-dione | ||
|---|---|---|---|---|
| CAS Number | 89510-42-9 | Molecular Weight | 256.29600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methoxy-4-(3-methylbut-2-enyl)naphthalene-1,2-dione |
|---|
| Molecular Formula | C16H16O3 |
|---|---|
| Molecular Weight | 256.29600 |
| Exact Mass | 256.11000 |
| PSA | 43.37000 |
| LogP | 3.16580 |
| InChIKey | DTLMHKINSJBZAM-UHFFFAOYSA-N |
| SMILES | COC1=C(CC=C(C)C)c2ccccc2C(=O)C1=O |
|
~%
3-methoxy-4-(3-... CAS#:89510-42-9 |
| Literature: Takuwa, Akio; Naruta, Yoshinori; Soga, Osamu; Maruyama, Kazuhiro Journal of Organic Chemistry, 1984 , vol. 49, # 11 p. 1857 - 1864 |
|
~%
3-methoxy-4-(3-... CAS#:89510-42-9 |
| Literature: Takuwa, Akio; Naruta, Yoshinori; Soga, Osamu; Maruyama, Kazuhiro Journal of Organic Chemistry, 1984 , vol. 49, # 11 p. 1857 - 1864 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |