(±)13(14)-EpDPA structure
|
Common Name | (±)13(14)-EpDPA | ||
|---|---|---|---|---|
| CAS Number | 895127-64-7 | Molecular Weight | 344.488 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 462.8±33.0 °C at 760 mmHg | |
| Molecular Formula | C22H32O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.8±18.9 °C | |
Use of (±)13(14)-EpDPA(±)13(14)-EpDPA (13,14-EpDPE) is the product of the reaction of cytochrome P-450 epoxygenase with Docosahexaenoic Acid (DHA).(±)13(14)-EpDPA has antihyperalgesic and vasorelaxative activities[1]. |
| Name | (±)13(14)-EpDPA |
|---|---|
| Synonym | More Synonyms |
| Description | (±)13(14)-EpDPA (13,14-EpDPE) is the product of the reaction of cytochrome P-450 epoxygenase with Docosahexaenoic Acid (DHA).(±)13(14)-EpDPA has antihyperalgesic and vasorelaxative activities[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 462.8±33.0 °C at 760 mmHg |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.488 |
| Flash Point | 150.8±18.9 °C |
| Exact Mass | 344.235138 |
| LogP | 6.40 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | DCFKVKFLEPMEGT-VABGYXHOSA-N |
| SMILES | CCC=CCC=CCC1OC1CC=CCC=CCC=CCCC(=O)O |
| (4Z,7Z,10Z)-12-{3-[(2Z,5Z)-2,5-Octadien-1-yl]-2-oxiranyl}-4,7,10-dodecatrienoic acid |
| 4,7,10-Dodecatrienoic acid, 12-[3-[(2Z,5Z)-2,5-octadien-1-yl]oxiranyl]-, (4Z,7Z,10Z)- |
| (4Z,7Z,10Z,16Z,19Z)-13,14-epoxydocosapentaenoic acid |