Cyclobutanecarbonyl chloride, 2,2,3,3-tetrafluoro-1-methyl structure
|
Common Name | Cyclobutanecarbonyl chloride, 2,2,3,3-tetrafluoro-1-methyl | ||
|---|---|---|---|---|
| CAS Number | 895157-70-7 | Molecular Weight | 204.55000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H5ClF4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Cyclobutanecarbonyl chloride, 2,2,3,3-tetrafluoro-1-methyl |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H5ClF4O |
|---|---|
| Molecular Weight | 204.55000 |
| Exact Mass | 203.99700 |
| PSA | 17.07000 |
| LogP | 2.43240 |
| InChIKey | STZSATOJCVOJNF-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)Cl)CC(F)(F)C1(F)F |
| HS Code | 2916209090 |
|---|
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2,2,3,3-TETRAFLUORO-1-(METHYL)CYCLOBUTANECARBONYL CHLORIDE |
| 2,2,3,3-Tetrafluoro-1-(methyl)cyclobutanecarbonyl chloride |