Methyl 3-[(2,3-dimethylphenyl)sulfamoyl]-4-phenylthiophene-2-carboxylate
Modify Date: 2026-09-24 23:16:49
![Methyl 3-[(2,3-dimethylphenyl)sulfamoyl]-4-phenylthiophene-2-carboxylate Structure](https://www.chemsrc.com/extcaspic/002/895263-79-3.png)
Methyl 3-[(2,3-dimethylphenyl)sulfamoyl]-4-phenylthiophene-2-carboxylate structure
|
Common Name | Methyl 3-[(2,3-dimethylphenyl)sulfamoyl]-4-phenylthiophene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 895263-79-3 | Molecular Weight | 401.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H19NO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 3-[(2,3-dimethylphenyl)sulfamoyl]-4-phenylthiophene-2-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H19NO4S2 |
|---|---|
| Molecular Weight | 401.5 |
| InChIKey | QUNLVGIQQCSWKU-UHFFFAOYSA-N |
| SMILES | COC(=O)c1scc(-c2ccccc2)c1S(=O)(=O)Nc1cccc(C)c1C |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 39, Current Page 1 of 4
1
2
3
4
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Methyl 3-[(2,3-dimethylphenyl)sulfamoyl]-4-phenylthiophene-2-carboxylate? |
| A: SMILES notation of Methyl 3-[(2,3-dimethylphenyl)sulfamoyl]-4-phenylthiophene-2-carboxylate is COC(=O)c1scc(-c2ccccc2)c1S(=O)(=O)Nc1cccc(C)c1C. |
| Q: What is the molecular formula of Methyl 3-[(2,3-dimethylphenyl)sulfamoyl]-4-phenylthiophene-2-carboxylate? |
| A: Molecular formula of Methyl 3-[(2,3-dimethylphenyl)sulfamoyl]-4-phenylthiophene-2-carboxylate is C20H19NO4S2. |
| Q: What is the CAS number of Methyl 3-[(2,3-dimethylphenyl)sulfamoyl]-4-phenylthiophene-2-carboxylate? |
| A: CAS number of Methyl 3-[(2,3-dimethylphenyl)sulfamoyl]-4-phenylthiophene-2-carboxylate is 895263-79-3. |
| Q: What is the English name of Methyl 3-[(2,3-dimethylphenyl)sulfamoyl]-4-phenylthiophene-2-carboxylate? |
| A: The English name of Methyl 3-[(2,3-dimethylphenyl)sulfamoyl]-4-phenylthiophene-2-carboxylate is Methyl 3-[(2,3-dimethylphenyl)sulfamoyl]-4-phenylthiophene-2-carboxylate. |
| Q: What is the Chinese name of 895263-79-3? |
| A: Chinese name of 895263-79-3 is 895263-79-3. |
| Q: What is the molecular weight of Methyl 3-[(2,3-dimethylphenyl)sulfamoyl]-4-phenylthiophene-2-carboxylate? |
| A: Molecular weight of Methyl 3-[(2,3-dimethylphenyl)sulfamoyl]-4-phenylthiophene-2-carboxylate is 401.5. |
| Q: What is the InChIKey of Methyl 3-[(2,3-dimethylphenyl)sulfamoyl]-4-phenylthiophene-2-carboxylate? |
| A: InChIKey of Methyl 3-[(2,3-dimethylphenyl)sulfamoyl]-4-phenylthiophene-2-carboxylate is QUNLVGIQQCSWKU-UHFFFAOYSA-N. |