diethyl 2-ethyl-2-(3-propan-2-yltellanylpropyl)propanedioate structure
|
Common Name | diethyl 2-ethyl-2-(3-propan-2-yltellanylpropyl)propanedioate | ||
|---|---|---|---|---|
| CAS Number | 89541-23-1 | Molecular Weight | 399.98000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H28O4Te | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2-ethyl-2-(3-propan-2-yltellanylpropyl)propanedioate |
|---|
| Molecular Formula | C15H28O4Te |
|---|---|
| Molecular Weight | 399.98000 |
| Exact Mass | 402.10500 |
| PSA | 52.60000 |
| LogP | 3.24000 |
| InChIKey | STDBIJGZYLXRME-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC)(CCC[Te]C(C)C)C(=O)OCC |
|
~%
diethyl 2-ethyl... CAS#:89541-23-1 |
| Literature: Grigsby, Robert A.; Irgolic, Kurt J.; Knapp, Furn F. Journal of Organometallic Chemistry, 1983 , vol. 259, # 2 p. 171 - 182 |
|
~%
diethyl 2-ethyl... CAS#:89541-23-1 |
| Literature: Grigsby, Robert A.; Irgolic, Kurt J.; Knapp, Furn F. Journal of Organometallic Chemistry, 1983 , vol. 259, # 2 p. 171 - 182 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |