Phosphinothioic acid,bis(tetrahydro-1(2H)-pyridazinyl)-, O-phenyl ester (9CI) structure
|
Common Name | Phosphinothioic acid,bis(tetrahydro-1(2H)-pyridazinyl)-, O-phenyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 89552-73-8 | Molecular Weight | 326.39700 | |
| Density | 1.29g/cm3 | Boiling Point | 426ºC at 760 mmHg | |
| Molecular Formula | C14H23N4OPS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.4ºC | |
| Name | bis(diazinan-1-yl)-phenoxy-sulfanylidene-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 426ºC at 760 mmHg |
| Molecular Formula | C14H23N4OPS |
| Molecular Weight | 326.39700 |
| Flash Point | 211.4ºC |
| Exact Mass | 326.13300 |
| PSA | 81.67000 |
| LogP | 3.67470 |
| Index of Refraction | 1.634 |
| InChIKey | WBYZROFSPHZNIR-UHFFFAOYSA-N |
| SMILES | S=P(Oc1ccccc1)(N1CCCCN1)N1CCCCN1 |
|
~74%
Phosphinothioic... CAS#:89552-73-8 |
| Literature: Engelhardt, Udo; Stromburg, Brigitte Phosphorus, Sulfur and Silicon and the Related Elements, 1989 , vol. 41, p. 235 - 252 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phosphinothioic acid,bis(tetrahydro-1(2H)-pyridazinyl)-,O-phenyl ester (9CI) |
| O-phenyl bis(hexahydropyridazido)thiophosphate |
| bis(hexahydro-1-pyridazinyl)thiophosphoric acid O-phenylester |
| Di(hexahydropyridazido)thiophosphorsaeure-O-phenylester |
| o-Phenyl ditetrahydro-1(2H)-pyridazinylphosphinothioate |
| bis(hexahydropyridazido)thiophosphoric acid O-phenyl ester |