N-tert-butyl-2-(2-chlorophenyl)ethenesulfonamide structure
|
Common Name | N-tert-butyl-2-(2-chlorophenyl)ethenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 89557-02-8 | Molecular Weight | 273.77900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-tert-butyl-2-(2-chlorophenyl)ethenesulfonamide |
|---|
| Molecular Formula | C12H16ClNO2S |
|---|---|
| Molecular Weight | 273.77900 |
| Exact Mass | 273.05900 |
| PSA | 54.55000 |
| LogP | 4.50030 |
| InChIKey | WVNNETPEUGBZLM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NS(=O)(=O)C=Cc1ccccc1Cl |
|
~96%
N-tert-butyl-2-... CAS#:89557-02-8 |
| Literature: Thompson, Mark E. Journal of Organic Chemistry, 1984 , vol. 49, # 10 p. 1700 - 1703 |
|
~%
N-tert-butyl-2-... CAS#:89557-02-8 |
| Literature: Thompson, Mark E. Journal of Organic Chemistry, 1984 , vol. 49, # 10 p. 1700 - 1703 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |