N-benzyl-1-(1-hydroxycyclohexyl)methanesulfonamide structure
|
Common Name | N-benzyl-1-(1-hydroxycyclohexyl)methanesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 89557-18-6 | Molecular Weight | 283.38600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H21NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-benzyl-1-(1-hydroxycyclohexyl)methanesulfonamide |
|---|
| Molecular Formula | C14H21NO3S |
|---|---|
| Molecular Weight | 283.38600 |
| Exact Mass | 283.12400 |
| PSA | 74.78000 |
| LogP | 3.27290 |
| InChIKey | FNCJVAAGIREGMY-UHFFFAOYSA-N |
| SMILES | O=S(=O)(CC1(O)CCCCC1)NCc1ccccc1 |
|
~%
N-benzyl-1-(1-h... CAS#:89557-18-6 |
| Literature: Thompson, Mark E. Journal of Organic Chemistry, 1984 , vol. 49, # 10 p. 1700 - 1703 |
|
~%
N-benzyl-1-(1-h... CAS#:89557-18-6 |
| Literature: Thompson, Mark E. Journal of Organic Chemistry, 1984 , vol. 49, # 10 p. 1700 - 1703 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |