4-tert-butyl-N,N-dimethyl-5-nitro-1,3-thiazol-2-amine structure
|
Common Name | 4-tert-butyl-N,N-dimethyl-5-nitro-1,3-thiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 89563-55-3 | Molecular Weight | 229.29900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H15N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-tert-butyl-N,N-dimethyl-5-nitro-1,3-thiazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H15N3O2S |
|---|---|
| Molecular Weight | 229.29900 |
| Exact Mass | 229.08800 |
| PSA | 90.19000 |
| LogP | 2.93800 |
| InChIKey | LHCFDDPXWBJWAD-UHFFFAOYSA-N |
| SMILES | CN(C)c1nc(C(C)(C)C)c([N+](=O)[O-])s1 |
|
~%
4-tert-butyl-N,... CAS#:89563-55-3 |
| Literature: Birkinshaw, Timothy N.; Gillon, David W.; Harkin, Shaun A.; Meakins, G. Denis; Tirel, Malkom D. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 2 p. 147 - 153 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-dimethylamino-5-nitro-4-t-butylthiazole |