4-(4-methoxyphenyl)-N,N-dimethyl-5-nitro-1,3-thiazol-2-amine structure
|
Common Name | 4-(4-methoxyphenyl)-N,N-dimethyl-5-nitro-1,3-thiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 89563-61-1 | Molecular Weight | 279.31500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-methoxyphenyl)-N,N-dimethyl-5-nitro-1,3-thiazol-2-amine |
|---|
| Molecular Formula | C12H13N3O3S |
|---|---|
| Molecular Weight | 279.31500 |
| Exact Mass | 279.06800 |
| PSA | 99.42000 |
| LogP | 3.31610 |
| InChIKey | HQVBSCDMPBRUJP-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2nc(N(C)C)sc2[N+](=O)[O-])cc1 |
|
~%
4-(4-methoxyphe... CAS#:89563-61-1 |
| Literature: Birkinshaw, Timothy N.; Gillon, David W.; Harkin, Shaun A.; Meakins, G. Denis; Tirel, Malkom D. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 2 p. 147 - 153 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |