3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one
![3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one Structure](https://image.chemsrc.com/caspic/224/89569-53-9.png)
3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one structure
|
Common Name | 3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one | ||
|---|---|---|---|---|
| CAS Number | 89569-53-9 | Molecular Weight | 370.40400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H18N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 3-[(2-Methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one (CAS: 89569-53-9, molecular formula: C22H18N4O2, molecular weight: 370.40400), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H18N4O2 |
|---|---|
| Molecular Weight | 370.40400 |
| Exact Mass | 370.14300 |
| PSA | 75.08000 |
| LogP | 1.79520 |
| InChIKey | VTFKDRUWBMVMNX-UHFFFAOYSA-N |
| SMILES | COc1ccccc1C(=NNc1ccccc1)c1nc2ccccc2[nH]c1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3-[(2-methoxyph... CAS#:89569-53-9 |
| Literature: Vinot, Nicole; Bellec, Christian; Maitte, Pierre Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 1645 - 1650 |
|
~%
3-[(2-methoxyph... CAS#:89569-53-9 |
| Literature: Vinot, Nicole; Bellec, Christian; Maitte, Pierre Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 1645 - 1650 |
![3-[(2-methoxyphenyl)methyl]-1H-quinoxalin-2-one structure](https://image.chemsrc.com/caspic/421/82500-92-3.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 1 | |
![3-(2-methoxyphenyl)-1-phenylpyrazolo[4,3-b]quinoxaline structure](https://image.chemsrc.com/caspic/176/89569-54-0.png)
CAS#:89569-54-0This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one? |
| A: InChIKey of 3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one is VTFKDRUWBMVMNX-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one? |
| A: Molecular weight of 3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one is 370.40400. |
| Q: What is the SMILES notation of 3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one? |
| A: SMILES notation of 3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one is COc1ccccc1C(=NNc1ccccc1)c1nc2ccccc2[nH]c1=O. |
| Q: What are the downstream products of 3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one? |
| A: Related downstream products(CAS) of 3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one: 89569-54-0. |
| Q: What is the CAS number of 3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one? |
| A: CAS number of 3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one is 89569-53-9. |
| Q: What is the LogP of 3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one? |
| A: LogP of 3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one is 1.79520. |
| Q: What are the upstream materials of 3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one? |
| A: Related upstream materials(CAS) of 3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one: 82500-92-3;89569-51-7;100-63-0. |
| Q: What is the molecular formula of 3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one? |
| A: Molecular formula of 3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one is C22H18N4O2. |
| Q: What is the polar surface area (PSA) of 3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one? |
| A: Polar surface area (PSA) of 3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one is 75.08000. |
| Q: What is the English name of 3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one? |
| A: The English name of 3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one is 3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one. |