1,3-bis(4-ethylphenyl)thiourea structure
|
Common Name | 1,3-bis(4-ethylphenyl)thiourea | ||
|---|---|---|---|---|
| CAS Number | 89573-81-9 | Molecular Weight | 284.41900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H20N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-bis(4-ethylphenyl)thiourea |
|---|
| Molecular Formula | C17H20N2S |
|---|---|
| Molecular Weight | 284.41900 |
| Exact Mass | 284.13500 |
| PSA | 56.15000 |
| LogP | 4.76630 |
| InChIKey | MYMPXETYPXXBNC-UHFFFAOYSA-N |
| SMILES | CCc1ccc(NC(=S)Nc2ccc(CC)cc2)cc1 |
|
~%
1,3-bis(4-ethyl... CAS#:89573-81-9 |
| Literature: Mainzer Chemische Berichte, 1883 , vol. 16, p. 2017 |
|
~%
1,3-bis(4-ethyl... CAS#:89573-81-9 |
| Literature: Sharma; Swaika; Mittal; Sindhwani Indian Journal of Chemistry - Section A Inorganic, Physical, Theoretical and Analytical Chemistry, 2001 , vol. 40, # 10 p. 1076 - 1081 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |