3-(1-Cyano-1,2-dimethylpropyl)benzoic acid
Modify Date: 2026-09-25 09:46:33
3-(1-Cyano-1,2-dimethylpropyl)benzoic acid structure
|
Common Name | 3-(1-Cyano-1,2-dimethylpropyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 896161-06-1 | Molecular Weight | 217.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(1-Cyano-1,2-dimethylpropyl)benzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15NO2 |
|---|---|
| Molecular Weight | 217.26 |
| InChIKey | NOCIDAGIGAVPPM-UHFFFAOYSA-N |
| SMILES | CC(C)C(C)(C#N)c1cccc(C(=O)O)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-(1-Cyano-1,2-dimethylpropyl)benzoic acid? |
| A: SMILES notation of 3-(1-Cyano-1,2-dimethylpropyl)benzoic acid is CC(C)C(C)(C#N)c1cccc(C(=O)O)c1. |
| Q: What is the English name of 3-(1-Cyano-1,2-dimethylpropyl)benzoic acid? |
| A: The English name of 3-(1-Cyano-1,2-dimethylpropyl)benzoic acid is 3-(1-Cyano-1,2-dimethylpropyl)benzoic acid. |
| Q: What is the InChIKey of 3-(1-Cyano-1,2-dimethylpropyl)benzoic acid? |
| A: InChIKey of 3-(1-Cyano-1,2-dimethylpropyl)benzoic acid is NOCIDAGIGAVPPM-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 896161-06-1? |
| A: Chinese name of 896161-06-1 is 896161-06-1. |
| Q: What is the CAS number of 3-(1-Cyano-1,2-dimethylpropyl)benzoic acid? |
| A: CAS number of 3-(1-Cyano-1,2-dimethylpropyl)benzoic acid is 896161-06-1. |
| Q: What is the molecular formula of 3-(1-Cyano-1,2-dimethylpropyl)benzoic acid? |
| A: Molecular formula of 3-(1-Cyano-1,2-dimethylpropyl)benzoic acid is C13H15NO2. |
| Q: What is the molecular weight of 3-(1-Cyano-1,2-dimethylpropyl)benzoic acid? |
| A: Molecular weight of 3-(1-Cyano-1,2-dimethylpropyl)benzoic acid is 217.26. |