Azacitidine Impurity 59
Modify Date: 2026-06-06 13:27:41
Azacitidine Impurity 59 structure
|
Common Name | Azacitidine Impurity 59 | ||
|---|---|---|---|---|
| CAS Number | 89618-11-1 | Molecular Weight | 243.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H13N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Azacitidine Impurity 59 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H13N3O5 |
|---|---|
| Molecular Weight | 243.22 |
| InChIKey | UHDGCWIWMRVCDJ-YTQLPXDHSA-N |
| SMILES | C1=CN(C(=O)N=C1N)[C@@H]2[C@H]([C@H]([C@H](O2)CO)O)O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 17, Current Page 1 of 2
1
2
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Azacitidine Impurity 59? |
| A: InChIKey of Azacitidine Impurity 59 is UHDGCWIWMRVCDJ-YTQLPXDHSA-N. |
| Q: What is the CAS number of Azacitidine Impurity 59? |
| A: CAS number of Azacitidine Impurity 59 is 89618-11-1. |
| Q: What is the molecular weight of Azacitidine Impurity 59? |
| A: Molecular weight of Azacitidine Impurity 59 is 243.22. |
| Q: What is the English name of Azacitidine Impurity 59? |
| A: The English name of Azacitidine Impurity 59 is Azacitidine Impurity 59. |
| Q: What is the Chinese name of 89618-11-1? |
| A: Chinese name of 89618-11-1 is 89618-11-1. |
| Q: What is the SMILES notation of Azacitidine Impurity 59? |
| A: SMILES notation of Azacitidine Impurity 59 is C1=CN(C(=O)N=C1N)[C@@H]2[C@H]([C@H]([C@H](O2)CO)O)O. |
| Q: What is the molecular formula of Azacitidine Impurity 59? |
| A: Molecular formula of Azacitidine Impurity 59 is C9H13N3O5. |