6-diphenylphosphoryl-1-hydroxydecan-5-one structure
|
Common Name | 6-diphenylphosphoryl-1-hydroxydecan-5-one | ||
|---|---|---|---|---|
| CAS Number | 89625-06-9 | Molecular Weight | 372.43800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H29O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-diphenylphosphoryl-1-hydroxydecan-5-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H29O3P |
|---|---|
| Molecular Weight | 372.43800 |
| Exact Mass | 372.18500 |
| PSA | 64.18000 |
| LogP | 4.29100 |
| InChIKey | IYVRRDYPRULNSO-UHFFFAOYSA-N |
| SMILES | CCCCC(C(=O)CCCCO)P(=O)(c1ccccc1)c1ccccc1 |
|
~85%
6-diphenylphosp... CAS#:89625-06-9 |
| Literature: Buss, Antony D.; Greeves, Nicholas; Mason, Ralph; Warren, Stuart Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1987 , p. 2569 - 2578 |
| 6-diphenylphosphinoyl-1-hydroxydecan-5-one |