4-ethoxy-N-[1-(4-ethoxyphenyl)-5-oxopyrrolidin-3-yl]benzamide
Modify Date: 2025-09-15 08:50:20
![4-ethoxy-N-[1-(4-ethoxyphenyl)-5-oxopyrrolidin-3-yl]benzamide Structure](https://www.chemsrc.com/extcaspic/421/896281-93-9.png)
4-ethoxy-N-[1-(4-ethoxyphenyl)-5-oxopyrrolidin-3-yl]benzamide structure
|
Common Name | 4-ethoxy-N-[1-(4-ethoxyphenyl)-5-oxopyrrolidin-3-yl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 896281-93-9 | Molecular Weight | 368.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H24N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-ethoxy-N-[1-(4-ethoxyphenyl)-5-oxopyrrolidin-3-yl]benzamide |
|---|
| Molecular Formula | C21H24N2O4 |
|---|---|
| Molecular Weight | 368.4 |
| InChIKey | PKZRCHXQRPKATI-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(=O)NC2CC(=O)N(c3ccc(OCC)cc3)C2)cc1 |
|
Name: Heme synthesis enzyme ferrochelatase (FECH) inhibition: small molecule primary screen
Source: 24913
Target: N/A
External Id: FECH 20K screen
|
|
Name: Small-molecule inhibitors of ST2 (IL1RL1)
Source: 20881
Target: interleukin-1 receptor-like 1 isoform [homo sapiens]
External Id: ST2_IL33_Inhibitors_Primary_Screening_77700
|
Total 2, Current Page 1 of 1
1