3,4-diethoxy-N-(1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl)benzamide
Modify Date: 2026-07-03 13:37:31
3,4-diethoxy-N-(1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl)benzamide structure
|
Common Name | 3,4-diethoxy-N-(1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 896294-43-2 | Molecular Weight | 386.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H23FN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,4-diethoxy-N-(1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl)benzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H23FN2O4 |
|---|---|
| Molecular Weight | 386.4 |
| InChIKey | QOLFJMWPVMXCFK-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(=O)NC2CC(=O)N(c3ccc(F)cc3)C2)cc1OCC |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Heme synthesis enzyme ferrochelatase (FECH) inhibition: small molecule primary screen
Source: 24913
Target: N/A
External Id: FECH 20K screen
|
|
Name: Small-molecule inhibitors of ST2 (IL1RL1)
Source: 20881
Target: interleukin-1 receptor-like 1 isoform [homo sapiens]
External Id: ST2_IL33_Inhibitors_Primary_Screening_77700
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 896294-43-2? |
| A: Chinese name of 896294-43-2 is 896294-43-2. |
| Q: What is the English name of 3,4-diethoxy-N-(1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl)benzamide? |
| A: The English name of 3,4-diethoxy-N-(1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl)benzamide is 3,4-diethoxy-N-(1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl)benzamide. |
| Q: What is the SMILES notation of 3,4-diethoxy-N-(1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl)benzamide? |
| A: SMILES notation of 3,4-diethoxy-N-(1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl)benzamide is CCOc1ccc(C(=O)NC2CC(=O)N(c3ccc(F)cc3)C2)cc1OCC. |
| Q: What is the CAS number of 3,4-diethoxy-N-(1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl)benzamide? |
| A: CAS number of 3,4-diethoxy-N-(1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl)benzamide is 896294-43-2. |
| Q: What is the molecular formula of 3,4-diethoxy-N-(1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl)benzamide? |
| A: Molecular formula of 3,4-diethoxy-N-(1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl)benzamide is C21H23FN2O4. |
| Q: What is the InChIKey of 3,4-diethoxy-N-(1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl)benzamide? |
| A: InChIKey of 3,4-diethoxy-N-(1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl)benzamide is QOLFJMWPVMXCFK-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3,4-diethoxy-N-(1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl)benzamide? |
| A: Molecular weight of 3,4-diethoxy-N-(1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl)benzamide is 386.4. |