Methyl (4,5-dimethyl-2-(3-phenoxybenzamido)thiophene-3-carbonyl)carbamate
Modify Date: 2026-08-05 10:23:32
Methyl (4,5-dimethyl-2-(3-phenoxybenzamido)thiophene-3-carbonyl)carbamate structure
|
Common Name | Methyl (4,5-dimethyl-2-(3-phenoxybenzamido)thiophene-3-carbonyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 896308-42-2 | Molecular Weight | 424.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H20N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl (4,5-dimethyl-2-(3-phenoxybenzamido)thiophene-3-carbonyl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H20N2O5S |
|---|---|
| Molecular Weight | 424.5 |
| InChIKey | MVROWXMPQTXCMP-UHFFFAOYSA-N |
| SMILES | COC(=O)NC(=O)c1c(NC(=O)c2cccc(Oc3ccccc3)c2)sc(C)c1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 896308-42-2? |
| A: Chinese name of 896308-42-2 is 896308-42-2. |
| Q: What is the English name of Methyl (4,5-dimethyl-2-(3-phenoxybenzamido)thiophene-3-carbonyl)carbamate? |
| A: The English name of Methyl (4,5-dimethyl-2-(3-phenoxybenzamido)thiophene-3-carbonyl)carbamate is Methyl (4,5-dimethyl-2-(3-phenoxybenzamido)thiophene-3-carbonyl)carbamate. |
| Q: What is the molecular formula of Methyl (4,5-dimethyl-2-(3-phenoxybenzamido)thiophene-3-carbonyl)carbamate? |
| A: Molecular formula of Methyl (4,5-dimethyl-2-(3-phenoxybenzamido)thiophene-3-carbonyl)carbamate is C22H20N2O5S. |
| Q: What is the InChIKey of Methyl (4,5-dimethyl-2-(3-phenoxybenzamido)thiophene-3-carbonyl)carbamate? |
| A: InChIKey of Methyl (4,5-dimethyl-2-(3-phenoxybenzamido)thiophene-3-carbonyl)carbamate is MVROWXMPQTXCMP-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Methyl (4,5-dimethyl-2-(3-phenoxybenzamido)thiophene-3-carbonyl)carbamate? |
| A: SMILES notation of Methyl (4,5-dimethyl-2-(3-phenoxybenzamido)thiophene-3-carbonyl)carbamate is COC(=O)NC(=O)c1c(NC(=O)c2cccc(Oc3ccccc3)c2)sc(C)c1C. |
| Q: What is the CAS number of Methyl (4,5-dimethyl-2-(3-phenoxybenzamido)thiophene-3-carbonyl)carbamate? |
| A: CAS number of Methyl (4,5-dimethyl-2-(3-phenoxybenzamido)thiophene-3-carbonyl)carbamate is 896308-42-2. |
| Q: What is the molecular weight of Methyl (4,5-dimethyl-2-(3-phenoxybenzamido)thiophene-3-carbonyl)carbamate? |
| A: Molecular weight of Methyl (4,5-dimethyl-2-(3-phenoxybenzamido)thiophene-3-carbonyl)carbamate is 424.5. |