2-[[4-(Trifluoromethyl)phenyl]methylsulfanyl]pyrido[1,2-a][1,3,5]triazin-4-one structure
|
Common Name | 2-[[4-(Trifluoromethyl)phenyl]methylsulfanyl]pyrido[1,2-a][1,3,5]triazin-4-one | ||
|---|---|---|---|---|
| CAS Number | 896331-13-8 | Molecular Weight | 337.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10F3N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[[4-(Trifluoromethyl)phenyl]methylsulfanyl]pyrido[1,2-a][1,3,5]triazin-4-one |
|---|
| Molecular Formula | C15H10F3N3OS |
|---|---|
| Molecular Weight | 337.3 |
| InChIKey | DKXWKVAZRPLCKG-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=NC(=O)N2C=C1)SCC3=CC=C(C=C3)C(F)(F)F |
|
Name: High Throughput Screening of small molecules that kill Mycobacterium tuberculosis
Source: 15607
Target: N/A
External Id: Cornell_MTB_2017
|