N-(2-(benzo[d][1,3]dioxol-5-yl)-2-(4-phenylpiperazin-1-yl)ethyl)-3,3-dimethylbutanamide
Modify Date: 2026-08-26 18:47:22
![N-(2-(benzo[d][1,3]dioxol-5-yl)-2-(4-phenylpiperazin-1-yl)ethyl)-3,3-dimethylbutanamide Structure](https://www.chemsrc.com/extcaspic/293/896348-12-2.png)
N-(2-(benzo[d][1,3]dioxol-5-yl)-2-(4-phenylpiperazin-1-yl)ethyl)-3,3-dimethylbutanamide structure
|
Common Name | N-(2-(benzo[d][1,3]dioxol-5-yl)-2-(4-phenylpiperazin-1-yl)ethyl)-3,3-dimethylbutanamide | ||
|---|---|---|---|---|
| CAS Number | 896348-12-2 | Molecular Weight | 423.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H33N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(2-(benzo[d][1,3]dioxol-5-yl)-2-(4-phenylpiperazin-1-yl)ethyl)-3,3-dimethylbutanamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H33N3O3 |
|---|---|
| Molecular Weight | 423.5 |
| InChIKey | ZDFWYKDCEILIDM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(=O)NCC(c1ccc2c(c1)OCO2)N1CCN(c2ccccc2)CC1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 38, Current Page 1 of 4
1
2
3
4
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N-(2-(benzo[d][1,3]dioxol-5-yl)-2-(4-phenylpiperazin-1-yl)ethyl)-3,3-dimethylbutanamide? |
| A: Molecular weight of N-(2-(benzo[d][1,3]dioxol-5-yl)-2-(4-phenylpiperazin-1-yl)ethyl)-3,3-dimethylbutanamide is 423.5. |
| Q: What is the Chinese name of 896348-12-2? |
| A: Chinese name of 896348-12-2 is 896348-12-2. |
| Q: What is the molecular formula of N-(2-(benzo[d][1,3]dioxol-5-yl)-2-(4-phenylpiperazin-1-yl)ethyl)-3,3-dimethylbutanamide? |
| A: Molecular formula of N-(2-(benzo[d][1,3]dioxol-5-yl)-2-(4-phenylpiperazin-1-yl)ethyl)-3,3-dimethylbutanamide is C25H33N3O3. |
| Q: What is the SMILES notation of N-(2-(benzo[d][1,3]dioxol-5-yl)-2-(4-phenylpiperazin-1-yl)ethyl)-3,3-dimethylbutanamide? |
| A: SMILES notation of N-(2-(benzo[d][1,3]dioxol-5-yl)-2-(4-phenylpiperazin-1-yl)ethyl)-3,3-dimethylbutanamide is CC(C)(C)CC(=O)NCC(c1ccc2c(c1)OCO2)N1CCN(c2ccccc2)CC1. |
| Q: What is the English name of N-(2-(benzo[d][1,3]dioxol-5-yl)-2-(4-phenylpiperazin-1-yl)ethyl)-3,3-dimethylbutanamide? |
| A: The English name of N-(2-(benzo[d][1,3]dioxol-5-yl)-2-(4-phenylpiperazin-1-yl)ethyl)-3,3-dimethylbutanamide is N-(2-(benzo[d][1,3]dioxol-5-yl)-2-(4-phenylpiperazin-1-yl)ethyl)-3,3-dimethylbutanamide. |
| Q: What is the CAS number of N-(2-(benzo[d][1,3]dioxol-5-yl)-2-(4-phenylpiperazin-1-yl)ethyl)-3,3-dimethylbutanamide? |
| A: CAS number of N-(2-(benzo[d][1,3]dioxol-5-yl)-2-(4-phenylpiperazin-1-yl)ethyl)-3,3-dimethylbutanamide is 896348-12-2. |
| Q: What is the InChIKey of N-(2-(benzo[d][1,3]dioxol-5-yl)-2-(4-phenylpiperazin-1-yl)ethyl)-3,3-dimethylbutanamide? |
| A: InChIKey of N-(2-(benzo[d][1,3]dioxol-5-yl)-2-(4-phenylpiperazin-1-yl)ethyl)-3,3-dimethylbutanamide is ZDFWYKDCEILIDM-UHFFFAOYSA-N. |