1-[2-(trifluoromethyl)phenyl]prop-2-en-1-one
Modify Date: 2025-09-30 18:33:21
![1-[2-(trifluoromethyl)phenyl]prop-2-en-1-one Structure](https://image.chemsrc.com/caspic/320/89638-22-2.png)
1-[2-(trifluoromethyl)phenyl]prop-2-en-1-one structure
|
Common Name | 1-[2-(trifluoromethyl)phenyl]prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 89638-22-2 | Molecular Weight | 200.15700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7F3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[2-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H7F3O |
|---|---|
| Molecular Weight | 200.15700 |
| Exact Mass | 200.04500 |
| PSA | 17.07000 |
| LogP | 3.07410 |
| InChIKey | OGBPULKUPNKENT-UHFFFAOYSA-N |
| SMILES | C=CC(=O)c1ccccc1C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 89638-22-2? |
| A: Chinese name of 89638-22-2 is 89638-22-2. |
| Q: What is the LogP of 1-[2-(trifluoromethyl)phenyl]prop-2-en-1-one? |
| A: LogP of 1-[2-(trifluoromethyl)phenyl]prop-2-en-1-one is 3.07410. |
| Q: What is the English name of 1-[2-(trifluoromethyl)phenyl]prop-2-en-1-one? |
| A: The English name of 1-[2-(trifluoromethyl)phenyl]prop-2-en-1-one is 1-[2-(trifluoromethyl)phenyl]prop-2-en-1-one. |
| Q: What is the molecular weight of 1-[2-(trifluoromethyl)phenyl]prop-2-en-1-one? |
| A: Molecular weight of 1-[2-(trifluoromethyl)phenyl]prop-2-en-1-one is 200.15700. |
| Q: What is the SMILES notation of 1-[2-(trifluoromethyl)phenyl]prop-2-en-1-one? |
| A: SMILES notation of 1-[2-(trifluoromethyl)phenyl]prop-2-en-1-one is C=CC(=O)c1ccccc1C(F)(F)F. |
| Q: What is the InChIKey of 1-[2-(trifluoromethyl)phenyl]prop-2-en-1-one? |
| A: InChIKey of 1-[2-(trifluoromethyl)phenyl]prop-2-en-1-one is OGBPULKUPNKENT-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-[2-(trifluoromethyl)phenyl]prop-2-en-1-one? |
| A: Molecular formula of 1-[2-(trifluoromethyl)phenyl]prop-2-en-1-one is C10H7F3O. |
| Q: What is the CAS number of 1-[2-(trifluoromethyl)phenyl]prop-2-en-1-one? |
| A: CAS number of 1-[2-(trifluoromethyl)phenyl]prop-2-en-1-one is 89638-22-2. |
| Q: What is the polar surface area (PSA) of 1-[2-(trifluoromethyl)phenyl]prop-2-en-1-one? |
| A: Polar surface area (PSA) of 1-[2-(trifluoromethyl)phenyl]prop-2-en-1-one is 17.07000. |