3-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-1H-quinazoline-2,4-dione structure
|
Common Name | 3-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-1H-quinazoline-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 896381-17-2 | Molecular Weight | 398.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H19ClN4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-1H-quinazoline-2,4-dione |
|---|
| Molecular Formula | C20H19ClN4O3 |
|---|---|
| Molecular Weight | 398.8 |
| InChIKey | MYTRKNFSVIWSBO-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=CC=C(C=C2)Cl)C(=O)CN3C(=O)C4=CC=CC=C4NC3=O |
|
Name: USP8 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 8
External Id: USP8 FAST DUB HTS Primary
|
|
Name: USP17 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 17 like family member 5
External Id: USP17 FAST DUB HTS Primary
|
|
Name: USP7 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 7
External Id: USP7 FAST DUB HTS Primary
|
|
Name: USP28 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 28
External Id: USP28 FAST DUB HTS Primary
|
|
Name: USP10 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 10
External Id: USP10 FAST DUB HTS Primary
|
|
Name: UCHL1 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin C-terminal hydrolase L1
External Id: UCHL1 FAST DUB HTS Primary
|
|
Name: OTUD3 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: OTU deubiquitinase 3
External Id: OTUD3 FAST DUB HTS Primary
|
|
Name: USP30 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 30
External Id: USP30 FAST DUB HTS Primary
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|