4a-methyl-2,3-dihydro-1H-carbazol-4-one
4a-methyl-2,3-dihydro-1H-carbazol-4-one structure
|
Common Name | 4a-methyl-2,3-dihydro-1H-carbazol-4-one | ||
|---|---|---|---|---|
| CAS Number | 89650-58-8 | Molecular Weight | 199.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4a-methyl-2,3-dihydro-1H-carbazol-4-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H13NO |
|---|---|
| Molecular Weight | 199.24800 |
| Exact Mass | 199.10000 |
| PSA | 29.43000 |
| LogP | 2.21900 |
| InChIKey | WNKUIXZIQAEZAS-UHFFFAOYSA-N |
| SMILES | CC12C(=O)CCCC1=Nc1ccccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~19%
4a-methyl-2,3-d... CAS#:89650-58-8 |
| Literature: Ban, Yoshio; Yoshida, Kiyoshi; Goto, Jiro; Oishi, Takeshi Journal of the American Chemical Society, 1981 , vol. 103, # 23 p. 6990 - 6992 |
|
~%
4a-methyl-2,3-d... CAS#:89650-58-8 |
| Literature: Ban, Yoshio; Yoshida, Kiyoshi; Goto, Jiro; Oishi, Takeshi; Takeda, Eiko; Ishigamori Tetrahedron, 1983 , vol. 39, # 22 p. 3657 - 3668 |
|
~%
4a-methyl-2,3-d... CAS#:89650-58-8 |
| Literature: Ban, Yoshio; Yoshida, Kiyoshi; Goto, Jiro; Oishi, Takeshi; Takeda, Eiko; Ishigamori Tetrahedron, 1983 , vol. 39, # 22 p. 3657 - 3668 |
![10-Methyl-8,9-dihydropyrido[1,2-a]indol-6(7H)-one structure](https://image.chemsrc.com/caspic/286/40133-76-4.png)
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4H-Carbazol-4-one,1,2,3,4a-tetrahydro-4a-methyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 4a-methyl-2,3-dihydro-1H-carbazol-4-one have? |
| A: English synonyms of 4a-methyl-2,3-dihydro-1H-carbazol-4-one: 4H-Carbazol-4-one,1,2,3,4a-tetrahydro-4a-methyl. |
| Q: What is the molecular formula of 4a-methyl-2,3-dihydro-1H-carbazol-4-one? |
| A: Molecular formula of 4a-methyl-2,3-dihydro-1H-carbazol-4-one is C13H13NO. |
| Q: What is the CAS number of 4a-methyl-2,3-dihydro-1H-carbazol-4-one? |
| A: CAS number of 4a-methyl-2,3-dihydro-1H-carbazol-4-one is 89650-58-8. |
| Q: What is the molecular weight of 4a-methyl-2,3-dihydro-1H-carbazol-4-one? |
| A: Molecular weight of 4a-methyl-2,3-dihydro-1H-carbazol-4-one is 199.24800. |
| Q: What is the LogP of 4a-methyl-2,3-dihydro-1H-carbazol-4-one? |
| A: LogP of 4a-methyl-2,3-dihydro-1H-carbazol-4-one is 2.21900. |
| Q: What is the English name of 4a-methyl-2,3-dihydro-1H-carbazol-4-one? |
| A: The English name of 4a-methyl-2,3-dihydro-1H-carbazol-4-one is 4a-methyl-2,3-dihydro-1H-carbazol-4-one. |
| Q: What is the InChIKey of 4a-methyl-2,3-dihydro-1H-carbazol-4-one? |
| A: InChIKey of 4a-methyl-2,3-dihydro-1H-carbazol-4-one is WNKUIXZIQAEZAS-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 89650-58-8? |
| A: Chinese name of 89650-58-8 is 89650-58-8. |
| Q: What is the SMILES notation of 4a-methyl-2,3-dihydro-1H-carbazol-4-one? |
| A: SMILES notation of 4a-methyl-2,3-dihydro-1H-carbazol-4-one is CC12C(=O)CCCC1=Nc1ccccc12. |
| Q: What is the polar surface area (PSA) of 4a-methyl-2,3-dihydro-1H-carbazol-4-one? |
| A: Polar surface area (PSA) of 4a-methyl-2,3-dihydro-1H-carbazol-4-one is 29.43000. |