3-chloro-2,6-dimethoxy-4-methylbenzoic acid
3-chloro-2,6-dimethoxy-4-methylbenzoic acid structure
|
Common Name | 3-chloro-2,6-dimethoxy-4-methylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 89653-72-5 | Molecular Weight | 230.64500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-chloro-2,6-dimethoxy-4-methylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H11ClO4 |
|---|---|
| Molecular Weight | 230.64500 |
| Exact Mass | 230.03500 |
| PSA | 55.76000 |
| LogP | 2.36380 |
| InChIKey | DADDNPUKOMFIRT-UHFFFAOYSA-N |
| SMILES | COc1cc(C)c(Cl)c(OC)c1C(=O)O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3-chloro-2,6-di... CAS#:89653-72-5 |
| Literature: Koller; Poepl Monatshefte fuer Chemie, 1934 , vol. 64, p. 126,129, 130 |
|
~%
3-chloro-2,6-di... CAS#:89653-72-5 |
| Literature: Koller; Poepl Monatshefte fuer Chemie, 1934 , vol. 64, p. 106,112 |
|
~%
3-chloro-2,6-di... CAS#:89653-72-5 |
| Literature: Koller; Poepl Monatshefte fuer Chemie, 1934 , vol. 64, p. 106,112 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzoic acid,3-chloro-2,6-dimethoxy-4-methyl |
| 3-Chlor-2,6-dimethoxy-4-methyl-benzoesaeure |
| 3-chloro-2,6-dimethoxy-4-methyl-benzoic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 3-chloro-2,6-dimethoxy-4-methylbenzoic acid? |
| A: LogP of 3-chloro-2,6-dimethoxy-4-methylbenzoic acid is 2.36380. |
| Q: What is the Chinese name of 89653-72-5? |
| A: Chinese name of 89653-72-5 is 89653-72-5. |
| Q: What is the SMILES notation of 3-chloro-2,6-dimethoxy-4-methylbenzoic acid? |
| A: SMILES notation of 3-chloro-2,6-dimethoxy-4-methylbenzoic acid is COc1cc(C)c(Cl)c(OC)c1C(=O)O. |
| Q: What is the InChIKey of 3-chloro-2,6-dimethoxy-4-methylbenzoic acid? |
| A: InChIKey of 3-chloro-2,6-dimethoxy-4-methylbenzoic acid is DADDNPUKOMFIRT-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-chloro-2,6-dimethoxy-4-methylbenzoic acid? |
| A: Molecular weight of 3-chloro-2,6-dimethoxy-4-methylbenzoic acid is 230.64500. |
| Q: What English synonyms does 3-chloro-2,6-dimethoxy-4-methylbenzoic acid have? |
| A: English synonyms of 3-chloro-2,6-dimethoxy-4-methylbenzoic acid: Benzoic acid,3-chloro-2,6-dimethoxy-4-methyl, 3-Chlor-2,6-dimethoxy-4-methyl-benzoesaeure, 3-chloro-2,6-dimethoxy-4-methyl-benzoic acid. |
| Q: What is the English name of 3-chloro-2,6-dimethoxy-4-methylbenzoic acid? |
| A: The English name of 3-chloro-2,6-dimethoxy-4-methylbenzoic acid is 3-chloro-2,6-dimethoxy-4-methylbenzoic acid. |
| Q: What is the CAS number of 3-chloro-2,6-dimethoxy-4-methylbenzoic acid? |
| A: CAS number of 3-chloro-2,6-dimethoxy-4-methylbenzoic acid is 89653-72-5. |
| Q: What is the molecular formula of 3-chloro-2,6-dimethoxy-4-methylbenzoic acid? |
| A: Molecular formula of 3-chloro-2,6-dimethoxy-4-methylbenzoic acid is C10H11ClO4. |
| Q: What is the polar surface area (PSA) of 3-chloro-2,6-dimethoxy-4-methylbenzoic acid? |
| A: Polar surface area (PSA) of 3-chloro-2,6-dimethoxy-4-methylbenzoic acid is 55.76000. |